C56H43NO3 — CID 145137928
6-ethyl-5-methyl-3-[4-(4-phenyl-N-spiro[1,2-dihydrofluorene-9,11'-benzo[a]fluorene]-9'-ylanilino)phenyl]benzene-1,2,4-triol (PubChem CID 145137928) has the molecular formula C56H43NO3 and a molecular weight of 777.96 g/mol. Its IUPAC name is 6-ethyl-5-methyl-3-[4-(4-phenyl-N-spiro[1,2-dihydrofluorene-9,11'-benzo[a]fluorene]-9'-ylanilino)phenyl]benzene-1,2,4-triol.
| Compound Name | 6-ethyl-5-methyl-3-[4-(4-phenyl-N-spiro[1,2-dihydrofluorene-9,11'-benzo[a]fluorene]-9'-ylanilino)phenyl]benzene-1,2,4-triol |
|---|---|
| PubChem CID | 145137928 |
| Molecular Formula | C56H43NO3 |
| Molecular Weight | 777.96 g/mol |
| Exact Mass | 777.32 |
| IUPAC Name | 6-ethyl-5-methyl-3-[4-(4-phenyl-N-spiro[1,2-dihydrofluorene-9,11'-benzo[a]fluorene]-9'-ylanilino)phenyl]benzene-1,2,4-triol |
| SMILES | CCc1c(C)c(O)c(-c2ccc(N(c3ccc(-c4ccccc4)cc3)c3ccc4c(c3)C3(C5=C(C=CCC5)c5ccccc53)c3c-4ccc4ccccc34)cc2)c(O)c1O |
| InChI | InChI=1S/C56H43NO3/c1-3-42-34(2)53(58)51(55(60)54(42)59)38-23-28-40(29-24-38)57(39-26-21-36(22-27-39)35-13-5-4-6-14-35)41-30-32-46-47-31-25-37-15-7-8-16-43(37)52(47)56(50(46)33-41)48-19-11-9-17-44(48)45-18-10-12-20-49(45)56/h4-11,13-19,21-33,58-60H,3,12,20H2,1-2H3 |
| InChIKey | YWCFGCZJYBFQAZ-UHFFFAOYSA-N |
| XLogP | 14.06 |
| TPSA | 63.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 60 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 777.96 |
| LogP ≤ 5 | 14.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|