C26H30F3IN4O2 — CID 145138213
N-[(4,6-dimethyl-2-oxo-1H-pyridin-3-yl)methyl]-1-[iodo-[(4S)-1-methyl-2-(trifluoromethyl)piperidin-4-yl]methyl]-2-methylindole-3-carboxamide (PubChem CID 145138213) has the molecular formula C26H30F3IN4O2 and a molecular weight of 614.45 g/mol. Its IUPAC name is N-[(4,6-dimethyl-2-oxo-1H-pyridin-3-yl)methyl]-1-[iodo-[(4S)-1-methyl-2-(trifluoromethyl)piperidin-4-yl]methyl]-2-methylindole-3-carboxamide.
| Compound Name | N-[(4,6-dimethyl-2-oxo-1H-pyridin-3-yl)methyl]-1-[iodo-[(4S)-1-methyl-2-(trifluoromethyl)piperidin-4-yl]methyl]-2-methylindole-3-carboxamide |
|---|---|
| PubChem CID | 145138213 |
| Molecular Formula | C26H30F3IN4O2 |
| Molecular Weight | 614.45 g/mol |
| Exact Mass | 614.14 |
| IUPAC Name | N-[(4,6-dimethyl-2-oxo-1H-pyridin-3-yl)methyl]-1-[iodo-[(4S)-1-methyl-2-(trifluoromethyl)piperidin-4-yl]methyl]-2-methylindole-3-carboxamide |
| SMILES | Cc1cc(C)c(CNC(=O)c2c(C)n(C(I)[C@H]3CCN(C)C(C(F)(F)F)C3)c3ccccc23)c(=O)[nH]1 |
| InChI | InChI=1S/C26H30F3IN4O2/c1-14-11-15(2)32-24(35)19(14)13-31-25(36)22-16(3)34(20-8-6-5-7-18(20)22)23(30)17-9-10-33(4)21(12-17)26(27,28)29/h5-8,11,17,21,23H,9-10,12-13H2,1-4H3,(H,31,36)(H,32,35)/t17-,21?,23?/m0/s1 |
| InChIKey | SXIWWSCIDIKOAK-HLFJOQDNSA-N |
| XLogP | 5.39 |
| TPSA | 70.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 614.45 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|