About ethene;1-(fluoromethoxy)-4-methoxycyclohexa-1,3-diene
ethene;1-(fluoromethoxy)-4-methoxycyclohexa-1,3-diene (PubChem CID 145138376) has the molecular formula C10H15FO2
and a molecular weight of 186.23 g/mol. Its IUPAC name is ethene;1-(fluoromethoxy)-4-methoxycyclohexa-1,3-diene.
Molecular Properties
| Compound Name | ethene;1-(fluoromethoxy)-4-methoxycyclohexa-1,3-diene |
| PubChem CID | 145138376 |
| Molecular Formula | C10H15FO2 |
| Molecular Weight | 186.23 g/mol |
| Exact Mass | 186.11 |
| IUPAC Name | ethene;1-(fluoromethoxy)-4-methoxycyclohexa-1,3-diene |
| SMILES | C=C.COC1=CC=C(OCF)CC1 |
| InChI | InChI=1S/C8H11FO2.C2H4/c1-10-7-2-4-8(5-3-7)11-6-9;1-2/h2,4H,3,5-6H2,1H3;1-2H2 |
| InChIKey | NOHOSMOUOBDJBZ-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 186.23 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze ethene;1-(fluoromethoxy)-4-methoxycyclohexa-1,3-diene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethene;1-(fluoromethoxy)-4-methoxycyclohexa-1,3-diene?
The IUPAC name of ethene;1-(fluoromethoxy)-4-methoxycyclohexa-1,3-diene (CID 145138376) is ethene;1-(fluoromethoxy)-4-methoxycyclohexa-1,3-diene.
What is the SMILES notation for ethene;1-(fluoromethoxy)-4-methoxycyclohexa-1,3-diene?
The canonical SMILES for ethene;1-(fluoromethoxy)-4-methoxycyclohexa-1,3-diene is C=C.COC1=CC=C(OCF)CC1.
What is the InChIKey of ethene;1-(fluoromethoxy)-4-methoxycyclohexa-1,3-diene?
The InChIKey is NOHOSMOUOBDJBZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H11FO2.C2H4/c1-10-7-2-4-8(5-3-7)11-6-9;1-2/h2,4H,3,5-6H2,1H3;1-2H2.
What are the key properties of ethene;1-(fluoromethoxy)-4-methoxycyclohexa-1,3-diene?
ethene;1-(fluoromethoxy)-4-methoxycyclohexa-1,3-diene has a molecular weight of 186.23 g/mol, XLogP of 2.94, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethene;1-(fluoromethoxy)-4-methoxycyclohexa-1,3-diene is sourced from PubChem (CID 145138376), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).