About (3Z)-3-ethenyl-4-(pyrrolidin-2-ylmethyl)hexa-3,5-dien-1-ol
(3Z)-3-ethenyl-4-(pyrrolidin-2-ylmethyl)hexa-3,5-dien-1-ol (PubChem CID 145138500) has the molecular formula C13H21NO
and a molecular weight of 207.32 g/mol. Its IUPAC name is (3Z)-3-ethenyl-4-(pyrrolidin-2-ylmethyl)hexa-3,5-dien-1-ol.
Molecular Properties
| Compound Name | (3Z)-3-ethenyl-4-(pyrrolidin-2-ylmethyl)hexa-3,5-dien-1-ol |
| PubChem CID | 145138500 |
| Molecular Formula | C13H21NO |
| Molecular Weight | 207.32 g/mol |
| Exact Mass | 207.16 |
| IUPAC Name | (3Z)-3-ethenyl-4-(pyrrolidin-2-ylmethyl)hexa-3,5-dien-1-ol |
| SMILES | C=C/C(CCO)=C(\C=C)CC1CCCN1 |
| InChI | InChI=1S/C13H21NO/c1-3-11(7-9-15)12(4-2)10-13-6-5-8-14-13/h3-4,13-15H,1-2,5-10H2/b12-11- |
| InChIKey | HBNUPFHDYUCPOX-QXMHVHEDSA-N |
| XLogP | 2.18 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 207.32 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze (3Z)-3-ethenyl-4-(pyrrolidin-2-ylmethyl)hexa-3,5-dien-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3Z)-3-ethenyl-4-(pyrrolidin-2-ylmethyl)hexa-3,5-dien-1-ol?
The IUPAC name of (3Z)-3-ethenyl-4-(pyrrolidin-2-ylmethyl)hexa-3,5-dien-1-ol (CID 145138500) is (3Z)-3-ethenyl-4-(pyrrolidin-2-ylmethyl)hexa-3,5-dien-1-ol.
What is the SMILES notation for (3Z)-3-ethenyl-4-(pyrrolidin-2-ylmethyl)hexa-3,5-dien-1-ol?
The canonical SMILES for (3Z)-3-ethenyl-4-(pyrrolidin-2-ylmethyl)hexa-3,5-dien-1-ol is C=C/C(CCO)=C(\C=C)CC1CCCN1.
What is the InChIKey of (3Z)-3-ethenyl-4-(pyrrolidin-2-ylmethyl)hexa-3,5-dien-1-ol?
The InChIKey is HBNUPFHDYUCPOX-QXMHVHEDSA-N. The full InChI is InChI=1S/C13H21NO/c1-3-11(7-9-15)12(4-2)10-13-6-5-8-14-13/h3-4,13-15H,1-2,5-10H2/b12-11-.
What are the key properties of (3Z)-3-ethenyl-4-(pyrrolidin-2-ylmethyl)hexa-3,5-dien-1-ol?
(3Z)-3-ethenyl-4-(pyrrolidin-2-ylmethyl)hexa-3,5-dien-1-ol has a molecular weight of 207.32 g/mol, XLogP of 2.18, 6 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (3Z)-3-ethenyl-4-(pyrrolidin-2-ylmethyl)hexa-3,5-dien-1-ol is sourced from PubChem (CID 145138500), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).