About (3Z)-4-[2-(2,2-dimethylpropylamino)ethyl]-3-ethenylhexa-3,5-dien-1-ol
(3Z)-4-[2-(2,2-dimethylpropylamino)ethyl]-3-ethenylhexa-3,5-dien-1-ol (PubChem CID 145138578) has the molecular formula C15H27NO
and a molecular weight of 237.39 g/mol. Its IUPAC name is (3Z)-4-[2-(2,2-dimethylpropylamino)ethyl]-3-ethenylhexa-3,5-dien-1-ol.
Molecular Properties
| Compound Name | (3Z)-4-[2-(2,2-dimethylpropylamino)ethyl]-3-ethenylhexa-3,5-dien-1-ol |
| PubChem CID | 145138578 |
| Molecular Formula | C15H27NO |
| Molecular Weight | 237.39 g/mol |
| Exact Mass | 237.21 |
| IUPAC Name | (3Z)-4-[2-(2,2-dimethylpropylamino)ethyl]-3-ethenylhexa-3,5-dien-1-ol |
| SMILES | C=C/C(CCO)=C(\C=C)CCNCC(C)(C)C |
| InChI | InChI=1S/C15H27NO/c1-6-13(14(7-2)9-11-17)8-10-16-12-15(3,4)5/h6-7,16-17H,1-2,8-12H2,3-5H3/b14-13- |
| InChIKey | RBSDKISGRIMIOT-YPKPFQOOSA-N |
| XLogP | 3.06 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 237.39 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze (3Z)-4-[2-(2,2-dimethylpropylamino)ethyl]-3-ethenylhexa-3,5-dien-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3Z)-4-[2-(2,2-dimethylpropylamino)ethyl]-3-ethenylhexa-3,5-dien-1-ol?
The IUPAC name of (3Z)-4-[2-(2,2-dimethylpropylamino)ethyl]-3-ethenylhexa-3,5-dien-1-ol (CID 145138578) is (3Z)-4-[2-(2,2-dimethylpropylamino)ethyl]-3-ethenylhexa-3,5-dien-1-ol.
What is the SMILES notation for (3Z)-4-[2-(2,2-dimethylpropylamino)ethyl]-3-ethenylhexa-3,5-dien-1-ol?
The canonical SMILES for (3Z)-4-[2-(2,2-dimethylpropylamino)ethyl]-3-ethenylhexa-3,5-dien-1-ol is C=C/C(CCO)=C(\C=C)CCNCC(C)(C)C.
What is the InChIKey of (3Z)-4-[2-(2,2-dimethylpropylamino)ethyl]-3-ethenylhexa-3,5-dien-1-ol?
The InChIKey is RBSDKISGRIMIOT-YPKPFQOOSA-N. The full InChI is InChI=1S/C15H27NO/c1-6-13(14(7-2)9-11-17)8-10-16-12-15(3,4)5/h6-7,16-17H,1-2,8-12H2,3-5H3/b14-13-.
What are the key properties of (3Z)-4-[2-(2,2-dimethylpropylamino)ethyl]-3-ethenylhexa-3,5-dien-1-ol?
(3Z)-4-[2-(2,2-dimethylpropylamino)ethyl]-3-ethenylhexa-3,5-dien-1-ol has a molecular weight of 237.39 g/mol, XLogP of 3.06, 8 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (3Z)-4-[2-(2,2-dimethylpropylamino)ethyl]-3-ethenylhexa-3,5-dien-1-ol is sourced from PubChem (CID 145138578), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).