C24H23N3O2 — CID 145138867
(8Z)-8-(hydroxymethylidene)-9a-methyl-3-phenyl-2-pyridin-4-yl-5,5a,6,9-tetrahydro-4H-benzo[e]benzimidazol-7-one (PubChem CID 145138867) has the molecular formula C24H23N3O2 and a molecular weight of 385.47 g/mol. Its IUPAC name is (8Z)-8-(hydroxymethylidene)-9a-methyl-3-phenyl-2-pyridin-4-yl-5,5a,6,9-tetrahydro-4H-benzo[e]benzimidazol-7-one.
| Compound Name | (8Z)-8-(hydroxymethylidene)-9a-methyl-3-phenyl-2-pyridin-4-yl-5,5a,6,9-tetrahydro-4H-benzo[e]benzimidazol-7-one |
|---|---|
| PubChem CID | 145138867 |
| Molecular Formula | C24H23N3O2 |
| Molecular Weight | 385.47 g/mol |
| Exact Mass | 385.18 |
| IUPAC Name | (8Z)-8-(hydroxymethylidene)-9a-methyl-3-phenyl-2-pyridin-4-yl-5,5a,6,9-tetrahydro-4H-benzo[e]benzimidazol-7-one |
| SMILES | CC12C/C(=C/O)C(=O)CC1CCc1c2nc(-c2ccncc2)n1-c1ccccc1 |
| InChI | InChI=1S/C24H23N3O2/c1-24-14-17(15-28)21(29)13-18(24)7-8-20-22(24)26-23(16-9-11-25-12-10-16)27(20)19-5-3-2-4-6-19/h2-6,9-12,15,18,28H,7-8,13-14H2,1H3/b17-15- |
| InChIKey | NXFFQRNRHWQDNK-ICFOKQHNSA-N |
| XLogP | 4.56 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.47 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'keto_keto_beta_D(5)', 'substructure': 'N/A'}, {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|