C28H32N2O2 — CID 145138958
(6S,9aS)-6,9a-dimethyl-3-phenyl-2-(2-phenylmethoxyethyl)-4,5,5a,6,8,9-hexahydrobenzo[e]benzimidazol-7-one (PubChem CID 145138958) has the molecular formula C28H32N2O2 and a molecular weight of 428.58 g/mol. Its IUPAC name is (6S,9aS)-6,9a-dimethyl-3-phenyl-2-(2-phenylmethoxyethyl)-4,5,5a,6,8,9-hexahydrobenzo[e]benzimidazol-7-one.
| Compound Name | (6S,9aS)-6,9a-dimethyl-3-phenyl-2-(2-phenylmethoxyethyl)-4,5,5a,6,8,9-hexahydrobenzo[e]benzimidazol-7-one |
|---|---|
| PubChem CID | 145138958 |
| Molecular Formula | C28H32N2O2 |
| Molecular Weight | 428.58 g/mol |
| Exact Mass | 428.25 |
| IUPAC Name | (6S,9aS)-6,9a-dimethyl-3-phenyl-2-(2-phenylmethoxyethyl)-4,5,5a,6,8,9-hexahydrobenzo[e]benzimidazol-7-one |
| SMILES | C[C@@H]1C(=O)CC[C@]2(C)c3nc(CCOCc4ccccc4)n(-c4ccccc4)c3CCC12 |
| InChI | InChI=1S/C28H32N2O2/c1-20-23-13-14-24-27(28(23,2)17-15-25(20)31)29-26(30(24)22-11-7-4-8-12-22)16-18-32-19-21-9-5-3-6-10-21/h3-12,20,23H,13-19H2,1-2H3/t20-,23?,28-/m0/s1 |
| InChIKey | MLAUISYYQKGWPY-BYGYQDPQSA-N |
| XLogP | 5.45 |
| TPSA | 44.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.58 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|