C28H40FN7O2 — CID 145139018
4-[amino-[(Z)-2-aminoethenyl]amino]-N-[5-amino-1-(4-methylpiperazin-1-yl)-1-oxopentan-2-yl]benzamide;1-cyclopropyl-4-fluorobenzene (PubChem CID 145139018) has the molecular formula C28H40FN7O2 and a molecular weight of 525.67 g/mol. Its IUPAC name is 4-[amino-[(Z)-2-aminoethenyl]amino]-N-[5-amino-1-(4-methylpiperazin-1-yl)-1-oxopentan-2-yl]benzamide;1-cyclopropyl-4-fluorobenzene.
| Compound Name | 4-[amino-[(Z)-2-aminoethenyl]amino]-N-[5-amino-1-(4-methylpiperazin-1-yl)-1-oxopentan-2-yl]benzamide;1-cyclopropyl-4-fluorobenzene |
|---|---|
| PubChem CID | 145139018 |
| Molecular Formula | C28H40FN7O2 |
| Molecular Weight | 525.67 g/mol |
| Exact Mass | 525.32 |
| IUPAC Name | 4-[amino-[(Z)-2-aminoethenyl]amino]-N-[5-amino-1-(4-methylpiperazin-1-yl)-1-oxopentan-2-yl]benzamide;1-cyclopropyl-4-fluorobenzene |
| SMILES | CN1CCN(C(=O)C(CCCN)NC(=O)c2ccc(N(N)/C=C\N)cc2)CC1.Fc1ccc(C2CC2)cc1 |
| InChI | InChI=1S/C19H31N7O2.C9H9F/c1-24-11-13-25(14-12-24)19(28)17(3-2-8-20)23-18(27)15-4-6-16(7-5-15)26(22)10-9-21;10-9-5-3-8(4-6-9)7-1-2-7/h4-7,9-10,17H,2-3,8,11-14,20-22H2,1H3,(H,23,27);3-7H,1-2H2/b10-9-; |
| InChIKey | UXVFZCRNVGTNMK-KVVVOXFISA-N |
| XLogP | 2.11 |
| TPSA | 133.95 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.67 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|