About 4-tert-butyl-N,2-dimethyl-6-propan-2-ylaniline
4-tert-butyl-N,2-dimethyl-6-propan-2-ylaniline (PubChem CID 145139465) has the molecular formula C15H25N
and a molecular weight of 219.37 g/mol. Its IUPAC name is 4-tert-butyl-N,2-dimethyl-6-propan-2-ylaniline.
Molecular Properties
| Compound Name | 4-tert-butyl-N,2-dimethyl-6-propan-2-ylaniline |
| PubChem CID | 145139465 |
| Molecular Formula | C15H25N |
| Molecular Weight | 219.37 g/mol |
| Exact Mass | 219.20 |
| IUPAC Name | 4-tert-butyl-N,2-dimethyl-6-propan-2-ylaniline |
| SMILES | CNc1c(C)cc(C(C)(C)C)cc1C(C)C |
| InChI | InChI=1S/C15H25N/c1-10(2)13-9-12(15(4,5)6)8-11(3)14(13)16-7/h8-10,16H,1-7H3 |
| InChIKey | BTPPAGCHIXRMTM-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 219.37 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 4-tert-butyl-N,2-dimethyl-6-propan-2-ylaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-tert-butyl-N,2-dimethyl-6-propan-2-ylaniline?
The IUPAC name of 4-tert-butyl-N,2-dimethyl-6-propan-2-ylaniline (CID 145139465) is 4-tert-butyl-N,2-dimethyl-6-propan-2-ylaniline.
What is the SMILES notation for 4-tert-butyl-N,2-dimethyl-6-propan-2-ylaniline?
The canonical SMILES for 4-tert-butyl-N,2-dimethyl-6-propan-2-ylaniline is CNc1c(C)cc(C(C)(C)C)cc1C(C)C.
What is the InChIKey of 4-tert-butyl-N,2-dimethyl-6-propan-2-ylaniline?
The InChIKey is BTPPAGCHIXRMTM-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H25N/c1-10(2)13-9-12(15(4,5)6)8-11(3)14(13)16-7/h8-10,16H,1-7H3.
What are the key properties of 4-tert-butyl-N,2-dimethyl-6-propan-2-ylaniline?
4-tert-butyl-N,2-dimethyl-6-propan-2-ylaniline has a molecular weight of 219.37 g/mol, XLogP of 4.46, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-tert-butyl-N,2-dimethyl-6-propan-2-ylaniline is sourced from PubChem (CID 145139465), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).