About ethane;formamide;4-methyl-2-(2-methylpropyl)-N-(oxan-4-ylmethyl)cyclohexan-1-amine
ethane;formamide;4-methyl-2-(2-methylpropyl)-N-(oxan-4-ylmethyl)cyclohexan-1-amine (PubChem CID 145139828) has the molecular formula C20H42N2O2
and a molecular weight of 342.57 g/mol. Its IUPAC name is ethane;formamide;4-methyl-2-(2-methylpropyl)-N-(oxan-4-ylmethyl)cyclohexan-1-amine.
Molecular Properties
| Compound Name | ethane;formamide;4-methyl-2-(2-methylpropyl)-N-(oxan-4-ylmethyl)cyclohexan-1-amine |
| PubChem CID | 145139828 |
| Molecular Formula | C20H42N2O2 |
| Molecular Weight | 342.57 g/mol |
| Exact Mass | 342.32 |
| IUPAC Name | ethane;formamide;4-methyl-2-(2-methylpropyl)-N-(oxan-4-ylmethyl)cyclohexan-1-amine |
| SMILES | CC.CC(C)CC1CC(C)CCC1NCC1CCOCC1.NC=O |
| InChI | InChI=1S/C17H33NO.C2H6.CH3NO/c1-13(2)10-16-11-14(3)4-5-17(16)18-12-15-6-8-19-9-7-15;1-2;2-1-3/h13-18H,4-12H2,1-3H3;1-2H3;1H,(H2,2,3) |
| InChIKey | KKVUBSHBUFWPGC-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 342.57 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze ethane;formamide;4-methyl-2-(2-methylpropyl)-N-(oxan-4-ylmethyl)cyclohexan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;formamide;4-methyl-2-(2-methylpropyl)-N-(oxan-4-ylmethyl)cyclohexan-1-amine?
The IUPAC name of ethane;formamide;4-methyl-2-(2-methylpropyl)-N-(oxan-4-ylmethyl)cyclohexan-1-amine (CID 145139828) is ethane;formamide;4-methyl-2-(2-methylpropyl)-N-(oxan-4-ylmethyl)cyclohexan-1-amine.
What is the SMILES notation for ethane;formamide;4-methyl-2-(2-methylpropyl)-N-(oxan-4-ylmethyl)cyclohexan-1-amine?
The canonical SMILES for ethane;formamide;4-methyl-2-(2-methylpropyl)-N-(oxan-4-ylmethyl)cyclohexan-1-amine is CC.CC(C)CC1CC(C)CCC1NCC1CCOCC1.NC=O.
What is the InChIKey of ethane;formamide;4-methyl-2-(2-methylpropyl)-N-(oxan-4-ylmethyl)cyclohexan-1-amine?
The InChIKey is KKVUBSHBUFWPGC-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H33NO.C2H6.CH3NO/c1-13(2)10-16-11-14(3)4-5-17(16)18-12-15-6-8-19-9-7-15;1-2;2-1-3/h13-18H,4-12H2,1-3H3;1-2H3;1H,(H2,2,3).
What are the key properties of ethane;formamide;4-methyl-2-(2-methylpropyl)-N-(oxan-4-ylmethyl)cyclohexan-1-amine?
ethane;formamide;4-methyl-2-(2-methylpropyl)-N-(oxan-4-ylmethyl)cyclohexan-1-amine has a molecular weight of 342.57 g/mol, XLogP of 3.98, 5 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;formamide;4-methyl-2-(2-methylpropyl)-N-(oxan-4-ylmethyl)cyclohexan-1-amine is sourced from PubChem (CID 145139828), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).