C15H27NO2 — CID 145139835
tert-butyl (2E)-4-ethyl-2-ethylidene-6-methylpiperidine-1-carboxylate (PubChem CID 145139835) has the molecular formula C15H27NO2 and a molecular weight of 253.39 g/mol. Its IUPAC name is tert-butyl (2E)-4-ethyl-2-ethylidene-6-methylpiperidine-1-carboxylate.
| Compound Name | tert-butyl (2E)-4-ethyl-2-ethylidene-6-methylpiperidine-1-carboxylate |
|---|---|
| PubChem CID | 145139835 |
| Molecular Formula | C15H27NO2 |
| Molecular Weight | 253.39 g/mol |
| Exact Mass | 253.20 |
| IUPAC Name | tert-butyl (2E)-4-ethyl-2-ethylidene-6-methylpiperidine-1-carboxylate |
| SMILES | C/C=C1\CC(CC)CC(C)N1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C15H27NO2/c1-7-12-9-11(3)16(13(8-2)10-12)14(17)18-15(4,5)6/h8,11-12H,7,9-10H2,1-6H3/b13-8+ |
| InChIKey | NQTSVHCJDMOLKN-MDWZMJQESA-N |
| XLogP | 4.34 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.39 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |