C19H24O7 — CID 145140113
(1S,8R,12R,13R,15S)-8,11-dihydroxy-6-(2-hydroxypropan-2-yl)-1,12-dimethyl-5,10,14-trioxapentacyclo[7.7.1.02,7.012,17.013,15]heptadeca-2,6-dien-4-one (PubChem CID 145140113) has the molecular formula C19H24O7 and a molecular weight of 364.39 g/mol. Its IUPAC name is (1S,8R,12R,13R,15S)-8,11-dihydroxy-6-(2-hydroxypropan-2-yl)-1,12-dimethyl-5,10,14-trioxapentacyclo[7.7.1.02,7.012,17.013,15]heptadeca-2,6-dien-4-one.
| Compound Name | (1S,8R,12R,13R,15S)-8,11-dihydroxy-6-(2-hydroxypropan-2-yl)-1,12-dimethyl-5,10,14-trioxapentacyclo[7.7.1.02,7.012,17.013,15]heptadeca-2,6-dien-4-one |
|---|---|
| PubChem CID | 145140113 |
| Molecular Formula | C19H24O7 |
| Molecular Weight | 364.39 g/mol |
| Exact Mass | 364.15 |
| IUPAC Name | (1S,8R,12R,13R,15S)-8,11-dihydroxy-6-(2-hydroxypropan-2-yl)-1,12-dimethyl-5,10,14-trioxapentacyclo[7.7.1.02,7.012,17.013,15]heptadeca-2,6-dien-4-one |
| SMILES | CC(C)(O)c1oc(=O)cc2c1[C@@H](O)C1OC(O)[C@]3(C)C1[C@]2(C)C[C@@H]1O[C@@H]13 |
| InChI | InChI=1S/C19H24O7/c1-17(2,23)15-10-7(5-9(20)25-15)18(3)6-8-14(24-8)19(4)13(18)12(11(10)21)26-16(19)22/h5,8,11-14,16,21-23H,6H2,1-4H3/t8-,11+,12?,13?,14-,16?,18+,19+/m0/s1 |
| InChIKey | CXKIJOITKMRFGP-JPCOKGKZSA-N |
| XLogP | 0.68 |
| TPSA | 112.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.39 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|