C21H30F2N4O2S2 — CID 145140423
[4-amino-2-(cyclohexylamino)-1,3-thiazol-5-yl]-(2,6-difluorophenyl)methanone;3-aminosulfanyl-2,2-dimethylpropan-1-ol (PubChem CID 145140423) has the molecular formula C21H30F2N4O2S2 and a molecular weight of 472.63 g/mol. Its IUPAC name is [4-amino-2-(cyclohexylamino)-1,3-thiazol-5-yl]-(2,6-difluorophenyl)methanone;3-aminosulfanyl-2,2-dimethylpropan-1-ol.
| Compound Name | [4-amino-2-(cyclohexylamino)-1,3-thiazol-5-yl]-(2,6-difluorophenyl)methanone;3-aminosulfanyl-2,2-dimethylpropan-1-ol |
|---|---|
| PubChem CID | 145140423 |
| Molecular Formula | C21H30F2N4O2S2 |
| Molecular Weight | 472.63 g/mol |
| Exact Mass | 472.18 |
| IUPAC Name | [4-amino-2-(cyclohexylamino)-1,3-thiazol-5-yl]-(2,6-difluorophenyl)methanone;3-aminosulfanyl-2,2-dimethylpropan-1-ol |
| SMILES | CC(C)(CO)CSN.Nc1nc(NC2CCCCC2)sc1C(=O)c1c(F)cccc1F |
| InChI | InChI=1S/C16H17F2N3OS.C5H13NOS/c17-10-7-4-8-11(18)12(10)13(22)14-15(19)21-16(23-14)20-9-5-2-1-3-6-9;1-5(2,3-7)4-8-6/h4,7-9H,1-3,5-6,19H2,(H,20,21);7H,3-4,6H2,1-2H3 |
| InChIKey | JYVVHHUJWHYBSG-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 114.26 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.63 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|