About N-(6-amino-3-fluoro-2,5-dimethylcyclohexa-2,4-dien-1-yl)-N-methylthiohydroxylamine
N-(6-amino-3-fluoro-2,5-dimethylcyclohexa-2,4-dien-1-yl)-N-methylthiohydroxylamine (PubChem CID 145140680) has the molecular formula C9H15FN2S
and a molecular weight of 202.30 g/mol. Its IUPAC name is N-(6-amino-3-fluoro-2,5-dimethylcyclohexa-2,4-dien-1-yl)-N-methylthiohydroxylamine.
Molecular Properties
| Compound Name | N-(6-amino-3-fluoro-2,5-dimethylcyclohexa-2,4-dien-1-yl)-N-methylthiohydroxylamine |
| PubChem CID | 145140680 |
| Molecular Formula | C9H15FN2S |
| Molecular Weight | 202.30 g/mol |
| Exact Mass | 202.09 |
| IUPAC Name | N-(6-amino-3-fluoro-2,5-dimethylcyclohexa-2,4-dien-1-yl)-N-methylthiohydroxylamine |
| SMILES | CC1=CC(F)=C(C)C(N(C)S)C1N |
| InChI | InChI=1S/C9H15FN2S/c1-5-4-7(10)6(2)9(8(5)11)12(3)13/h4,8-9,13H,11H2,1-3H3 |
| InChIKey | LLIYEGBXVRYIJD-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 202.30 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze N-(6-amino-3-fluoro-2,5-dimethylcyclohexa-2,4-dien-1-yl)-N-methylthiohydroxylamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(6-amino-3-fluoro-2,5-dimethylcyclohexa-2,4-dien-1-yl)-N-methylthiohydroxylamine?
The IUPAC name of N-(6-amino-3-fluoro-2,5-dimethylcyclohexa-2,4-dien-1-yl)-N-methylthiohydroxylamine (CID 145140680) is N-(6-amino-3-fluoro-2,5-dimethylcyclohexa-2,4-dien-1-yl)-N-methylthiohydroxylamine.
What is the SMILES notation for N-(6-amino-3-fluoro-2,5-dimethylcyclohexa-2,4-dien-1-yl)-N-methylthiohydroxylamine?
The canonical SMILES for N-(6-amino-3-fluoro-2,5-dimethylcyclohexa-2,4-dien-1-yl)-N-methylthiohydroxylamine is CC1=CC(F)=C(C)C(N(C)S)C1N.
What is the InChIKey of N-(6-amino-3-fluoro-2,5-dimethylcyclohexa-2,4-dien-1-yl)-N-methylthiohydroxylamine?
The InChIKey is LLIYEGBXVRYIJD-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H15FN2S/c1-5-4-7(10)6(2)9(8(5)11)12(3)13/h4,8-9,13H,11H2,1-3H3.
What are the key properties of N-(6-amino-3-fluoro-2,5-dimethylcyclohexa-2,4-dien-1-yl)-N-methylthiohydroxylamine?
N-(6-amino-3-fluoro-2,5-dimethylcyclohexa-2,4-dien-1-yl)-N-methylthiohydroxylamine has a molecular weight of 202.30 g/mol, XLogP of 1.66, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-(6-amino-3-fluoro-2,5-dimethylcyclohexa-2,4-dien-1-yl)-N-methylthiohydroxylamine is sourced from PubChem (CID 145140680), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).