C25H20Cl2F3N5O2 — CID 145141312
2,6-dichloro-N-[(7R)-2,7-dimethyl-10-(2,2,2-trifluoroacetyl)-8,9-dihydro-6H-pyrido[1,2-a]indol-7-yl]-4-(1,2,4-triazol-4-yl)benzamide (PubChem CID 145141312) has the molecular formula C25H20Cl2F3N5O2 and a molecular weight of 550.37 g/mol. Its IUPAC name is 2,6-dichloro-N-[(7R)-2,7-dimethyl-10-(2,2,2-trifluoroacetyl)-8,9-dihydro-6H-pyrido[1,2-a]indol-7-yl]-4-(1,2,4-triazol-4-yl)benzamide.
| Compound Name | 2,6-dichloro-N-[(7R)-2,7-dimethyl-10-(2,2,2-trifluoroacetyl)-8,9-dihydro-6H-pyrido[1,2-a]indol-7-yl]-4-(1,2,4-triazol-4-yl)benzamide |
|---|---|
| PubChem CID | 145141312 |
| Molecular Formula | C25H20Cl2F3N5O2 |
| Molecular Weight | 550.37 g/mol |
| Exact Mass | 549.09 |
| IUPAC Name | 2,6-dichloro-N-[(7R)-2,7-dimethyl-10-(2,2,2-trifluoroacetyl)-8,9-dihydro-6H-pyrido[1,2-a]indol-7-yl]-4-(1,2,4-triazol-4-yl)benzamide |
| SMILES | Cc1ccc2c(c1)c(C(=O)C(F)(F)F)c1n2C[C@](C)(NC(=O)c2c(Cl)cc(-n3cnnc3)cc2Cl)CC1 |
| InChI | InChI=1S/C25H20Cl2F3N5O2/c1-13-3-4-18-15(7-13)20(22(36)25(28,29)30)19-5-6-24(2,10-35(18)19)33-23(37)21-16(26)8-14(9-17(21)27)34-11-31-32-12-34/h3-4,7-9,11-12H,5-6,10H2,1-2H3,(H,33,37)/t24-/m1/s1 |
| InChIKey | VRIGITLZWVYCBD-XMMPIXPASA-N |
| XLogP | 5.72 |
| TPSA | 81.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.37 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |