About 5-(2-chloro-3-pyridinyl)-1H-indazole;ethane;3-methylpyridine
5-(2-chloro-3-pyridinyl)-1H-indazole;ethane;3-methylpyridine (PubChem CID 145141486) has the molecular formula C22H27ClN4
and a molecular weight of 382.94 g/mol. Its IUPAC name is 5-(2-chloro-3-pyridinyl)-1H-indazole;ethane;3-methylpyridine.
Molecular Properties
| Compound Name | 5-(2-chloro-3-pyridinyl)-1H-indazole;ethane;3-methylpyridine |
| PubChem CID | 145141486 |
| Molecular Formula | C22H27ClN4 |
| Molecular Weight | 382.94 g/mol |
| Exact Mass | 382.19 |
| IUPAC Name | 5-(2-chloro-3-pyridinyl)-1H-indazole;ethane;3-methylpyridine |
| SMILES | CC.CC.Cc1cccnc1.Clc1ncccc1-c1ccc2[nH]ncc2c1 |
| InChI | InChI=1S/C12H8ClN3.C6H7N.2C2H6/c13-12-10(2-1-5-14-12)8-3-4-11-9(6-8)7-15-16-11;1-6-3-2-4-7-5-6;2*1-2/h1-7H,(H,15,16);2-5H,1H3;2*1-2H3 |
| InChIKey | NDNDMBSCPXXXCX-UHFFFAOYSA-N |
| XLogP | 6.72 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 382.94 |
| LogP ≤ 5 | 6.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|
Analyze 5-(2-chloro-3-pyridinyl)-1H-indazole;ethane;3-methylpyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(2-chloro-3-pyridinyl)-1H-indazole;ethane;3-methylpyridine?
The IUPAC name of 5-(2-chloro-3-pyridinyl)-1H-indazole;ethane;3-methylpyridine (CID 145141486) is 5-(2-chloro-3-pyridinyl)-1H-indazole;ethane;3-methylpyridine.
What is the SMILES notation for 5-(2-chloro-3-pyridinyl)-1H-indazole;ethane;3-methylpyridine?
The canonical SMILES for 5-(2-chloro-3-pyridinyl)-1H-indazole;ethane;3-methylpyridine is CC.CC.Cc1cccnc1.Clc1ncccc1-c1ccc2[nH]ncc2c1.
What is the InChIKey of 5-(2-chloro-3-pyridinyl)-1H-indazole;ethane;3-methylpyridine?
The InChIKey is NDNDMBSCPXXXCX-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H8ClN3.C6H7N.2C2H6/c13-12-10(2-1-5-14-12)8-3-4-11-9(6-8)7-15-16-11;1-6-3-2-4-7-5-6;2*1-2/h1-7H,(H,15,16);2-5H,1H3;2*1-2H3.
What are the key properties of 5-(2-chloro-3-pyridinyl)-1H-indazole;ethane;3-methylpyridine?
5-(2-chloro-3-pyridinyl)-1H-indazole;ethane;3-methylpyridine has a molecular weight of 382.94 g/mol, XLogP of 6.72, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(2-chloro-3-pyridinyl)-1H-indazole;ethane;3-methylpyridine is sourced from PubChem (CID 145141486), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).