About 3,5-dimethyl-[1,2]oxazolo[4,3-d]pyrimidine;methane
3,5-dimethyl-[1,2]oxazolo[4,3-d]pyrimidine;methane (PubChem CID 145141632) has the molecular formula C8H11N3O
and a molecular weight of 165.20 g/mol. Its IUPAC name is 3,5-dimethyl-[1,2]oxazolo[4,3-d]pyrimidine;methane.
Molecular Properties
| Compound Name | 3,5-dimethyl-[1,2]oxazolo[4,3-d]pyrimidine;methane |
| PubChem CID | 145141632 |
| Molecular Formula | C8H11N3O |
| Molecular Weight | 165.20 g/mol |
| Exact Mass | 165.09 |
| IUPAC Name | 3,5-dimethyl-[1,2]oxazolo[4,3-d]pyrimidine;methane |
| SMILES | C.Cc1ncc2noc(C)c2n1 |
| InChI | InChI=1S/C7H7N3O.CH4/c1-4-7-6(10-11-4)3-8-5(2)9-7;/h3H,1-2H3;1H4 |
| InChIKey | QDWVCFDCXRNTDW-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 51.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 165.20 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3,5-dimethyl-[1,2]oxazolo[4,3-d]pyrimidine;methane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,5-dimethyl-[1,2]oxazolo[4,3-d]pyrimidine;methane?
The IUPAC name of 3,5-dimethyl-[1,2]oxazolo[4,3-d]pyrimidine;methane (CID 145141632) is 3,5-dimethyl-[1,2]oxazolo[4,3-d]pyrimidine;methane.
What is the SMILES notation for 3,5-dimethyl-[1,2]oxazolo[4,3-d]pyrimidine;methane?
The canonical SMILES for 3,5-dimethyl-[1,2]oxazolo[4,3-d]pyrimidine;methane is C.Cc1ncc2noc(C)c2n1.
What is the InChIKey of 3,5-dimethyl-[1,2]oxazolo[4,3-d]pyrimidine;methane?
The InChIKey is QDWVCFDCXRNTDW-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H7N3O.CH4/c1-4-7-6(10-11-4)3-8-5(2)9-7;/h3H,1-2H3;1H4.
What are the key properties of 3,5-dimethyl-[1,2]oxazolo[4,3-d]pyrimidine;methane?
3,5-dimethyl-[1,2]oxazolo[4,3-d]pyrimidine;methane has a molecular weight of 165.20 g/mol, XLogP of 1.87, 0 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3,5-dimethyl-[1,2]oxazolo[4,3-d]pyrimidine;methane is sourced from PubChem (CID 145141632), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).