About methane;3-methyl-5-propan-2-yl-[1,2]oxazolo[4,5-d]pyrimidine
methane;3-methyl-5-propan-2-yl-[1,2]oxazolo[4,5-d]pyrimidine (PubChem CID 145141656) has the molecular formula C10H15N3O
and a molecular weight of 193.25 g/mol. Its IUPAC name is methane;3-methyl-5-propan-2-yl-[1,2]oxazolo[4,5-d]pyrimidine.
Molecular Properties
| Compound Name | methane;3-methyl-5-propan-2-yl-[1,2]oxazolo[4,5-d]pyrimidine |
| PubChem CID | 145141656 |
| Molecular Formula | C10H15N3O |
| Molecular Weight | 193.25 g/mol |
| Exact Mass | 193.12 |
| IUPAC Name | methane;3-methyl-5-propan-2-yl-[1,2]oxazolo[4,5-d]pyrimidine |
| SMILES | C.Cc1noc2cnc(C(C)C)nc12 |
| InChI | InChI=1S/C9H11N3O.CH4/c1-5(2)9-10-4-7-8(11-9)6(3)12-13-7;/h4-5H,1-3H3;1H4 |
| InChIKey | TVCPPBXKRVXMDP-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 51.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 193.25 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze methane;3-methyl-5-propan-2-yl-[1,2]oxazolo[4,5-d]pyrimidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methane;3-methyl-5-propan-2-yl-[1,2]oxazolo[4,5-d]pyrimidine?
The IUPAC name of methane;3-methyl-5-propan-2-yl-[1,2]oxazolo[4,5-d]pyrimidine (CID 145141656) is methane;3-methyl-5-propan-2-yl-[1,2]oxazolo[4,5-d]pyrimidine.
What is the SMILES notation for methane;3-methyl-5-propan-2-yl-[1,2]oxazolo[4,5-d]pyrimidine?
The canonical SMILES for methane;3-methyl-5-propan-2-yl-[1,2]oxazolo[4,5-d]pyrimidine is C.Cc1noc2cnc(C(C)C)nc12.
What is the InChIKey of methane;3-methyl-5-propan-2-yl-[1,2]oxazolo[4,5-d]pyrimidine?
The InChIKey is TVCPPBXKRVXMDP-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H11N3O.CH4/c1-5(2)9-10-4-7-8(11-9)6(3)12-13-7;/h4-5H,1-3H3;1H4.
What are the key properties of methane;3-methyl-5-propan-2-yl-[1,2]oxazolo[4,5-d]pyrimidine?
methane;3-methyl-5-propan-2-yl-[1,2]oxazolo[4,5-d]pyrimidine has a molecular weight of 193.25 g/mol, XLogP of 2.69, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methane;3-methyl-5-propan-2-yl-[1,2]oxazolo[4,5-d]pyrimidine is sourced from PubChem (CID 145141656), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).