C25H42O2 — CID 145141707
ethane;4-methoxy-6-methyl-5-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]cyclohex-2-en-1-one (PubChem CID 145141707) has the molecular formula C25H42O2 and a molecular weight of 374.61 g/mol. Its IUPAC name is ethane;4-methoxy-6-methyl-5-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]cyclohex-2-en-1-one.
| Compound Name | ethane;4-methoxy-6-methyl-5-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]cyclohex-2-en-1-one |
|---|---|
| PubChem CID | 145141707 |
| Molecular Formula | C25H42O2 |
| Molecular Weight | 374.61 g/mol |
| Exact Mass | 374.32 |
| IUPAC Name | ethane;4-methoxy-6-methyl-5-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]cyclohex-2-en-1-one |
| SMILES | CC.COC1C=CC(=O)C(C)C1C/C=C(\C)CC/C=C(\C)CCC=C(C)C |
| InChI | InChI=1S/C23H36O2.C2H6/c1-17(2)9-7-10-18(3)11-8-12-19(4)13-14-21-20(5)22(24)15-16-23(21)25-6;1-2/h9,11,13,15-16,20-21,23H,7-8,10,12,14H2,1-6H3;1-2H3/b18-11+,19-13+; |
| InChIKey | UOARTZQRXZNUSA-XMNSKKDHSA-N |
| XLogP | 7.23 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.61 |
| LogP ≤ 5 | 7.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|