C33H40F2N4O4 — CID 145142611
N-[(Z)-3-[7-(2,6-difluoro-3,5-dimethoxyphenyl)-6-methylidenespiro[8H-2,7-naphthyridine-5,1'-cyclopropane]-3-yl]-1-methyliminobut-2-en-2-yl]prop-2-enamide;4-methyloxane (PubChem CID 145142611) has the molecular formula C33H40F2N4O4 and a molecular weight of 594.70 g/mol. Its IUPAC name is N-[(Z)-3-[7-(2,6-difluoro-3,5-dimethoxyphenyl)-6-methylidenespiro[8H-2,7-naphthyridine-5,1'-cyclopropane]-3-yl]-1-methyliminobut-2-en-2-yl]prop-2-enamide;4-methyloxane.
| Compound Name | N-[(Z)-3-[7-(2,6-difluoro-3,5-dimethoxyphenyl)-6-methylidenespiro[8H-2,7-naphthyridine-5,1'-cyclopropane]-3-yl]-1-methyliminobut-2-en-2-yl]prop-2-enamide;4-methyloxane |
|---|---|
| PubChem CID | 145142611 |
| Molecular Formula | C33H40F2N4O4 |
| Molecular Weight | 594.70 g/mol |
| Exact Mass | 594.30 |
| IUPAC Name | N-[(Z)-3-[7-(2,6-difluoro-3,5-dimethoxyphenyl)-6-methylidenespiro[8H-2,7-naphthyridine-5,1'-cyclopropane]-3-yl]-1-methyliminobut-2-en-2-yl]prop-2-enamide;4-methyloxane |
| SMILES | C=CC(=O)NC(/C=N/C)=C(/C)c1cc2c(cn1)CN(c1c(F)c(OC)cc(OC)c1F)C(=C)C21CC1.CC1CCOCC1 |
| InChI | InChI=1S/C27H28F2N4O3.C6H12O/c1-7-23(34)32-20(13-30-4)15(2)19-10-18-17(12-31-19)14-33(16(3)27(18)8-9-27)26-24(28)21(35-5)11-22(36-6)25(26)29;1-6-2-4-7-5-3-6/h7,10-13H,1,3,8-9,14H2,2,4-6H3,(H,32,34);6H,2-5H2,1H3/b20-15-,30-13+; |
| InChIKey | MRCLSQIGUNDQHT-WMYRXZLISA-N |
| XLogP | 6.11 |
| TPSA | 85.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 594.70 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|