About (4-ethylphenyl)methanamine;(E)-1-methylsulfanylprop-1-ene
(4-ethylphenyl)methanamine;(E)-1-methylsulfanylprop-1-ene (PubChem CID 145142971) has the molecular formula C13H21NS
and a molecular weight of 223.38 g/mol. Its IUPAC name is (4-ethylphenyl)methanamine;(E)-1-methylsulfanylprop-1-ene.
Molecular Properties
| Compound Name | (4-ethylphenyl)methanamine;(E)-1-methylsulfanylprop-1-ene |
| PubChem CID | 145142971 |
| Molecular Formula | C13H21NS |
| Molecular Weight | 223.38 g/mol |
| Exact Mass | 223.14 |
| IUPAC Name | (4-ethylphenyl)methanamine;(E)-1-methylsulfanylprop-1-ene |
| SMILES | C/C=C/SC.CCc1ccc(CN)cc1 |
| InChI | InChI=1S/C9H13N.C4H8S/c1-2-8-3-5-9(7-10)6-4-8;1-3-4-5-2/h3-6H,2,7,10H2,1H3;3-4H,1-2H3/b;4-3+ |
| InChIKey | RGZWFLJBRUMHSB-SCBDLNNBSA-N |
| XLogP | 3.59 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 223.38 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (4-ethylphenyl)methanamine;(E)-1-methylsulfanylprop-1-ene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-ethylphenyl)methanamine;(E)-1-methylsulfanylprop-1-ene?
The IUPAC name of (4-ethylphenyl)methanamine;(E)-1-methylsulfanylprop-1-ene (CID 145142971) is (4-ethylphenyl)methanamine;(E)-1-methylsulfanylprop-1-ene.
What is the SMILES notation for (4-ethylphenyl)methanamine;(E)-1-methylsulfanylprop-1-ene?
The canonical SMILES for (4-ethylphenyl)methanamine;(E)-1-methylsulfanylprop-1-ene is C/C=C/SC.CCc1ccc(CN)cc1.
What is the InChIKey of (4-ethylphenyl)methanamine;(E)-1-methylsulfanylprop-1-ene?
The InChIKey is RGZWFLJBRUMHSB-SCBDLNNBSA-N. The full InChI is InChI=1S/C9H13N.C4H8S/c1-2-8-3-5-9(7-10)6-4-8;1-3-4-5-2/h3-6H,2,7,10H2,1H3;3-4H,1-2H3/b;4-3+.
What are the key properties of (4-ethylphenyl)methanamine;(E)-1-methylsulfanylprop-1-ene?
(4-ethylphenyl)methanamine;(E)-1-methylsulfanylprop-1-ene has a molecular weight of 223.38 g/mol, XLogP of 3.59, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (4-ethylphenyl)methanamine;(E)-1-methylsulfanylprop-1-ene is sourced from PubChem (CID 145142971), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).