About 2-(5-ethynyl-2-methylphenyl)-1,3-thiazole-4-carboxamide;3-hydroxy-1-methylpyrrolidin-2-one
2-(5-ethynyl-2-methylphenyl)-1,3-thiazole-4-carboxamide;3-hydroxy-1-methylpyrrolidin-2-one (PubChem CID 145143428) has the molecular formula C18H19N3O3S
and a molecular weight of 357.44 g/mol. Its IUPAC name is 2-(5-ethynyl-2-methylphenyl)-1,3-thiazole-4-carboxamide;3-hydroxy-1-methylpyrrolidin-2-one.
Molecular Properties
| Compound Name | 2-(5-ethynyl-2-methylphenyl)-1,3-thiazole-4-carboxamide;3-hydroxy-1-methylpyrrolidin-2-one |
| PubChem CID | 145143428 |
| Molecular Formula | C18H19N3O3S |
| Molecular Weight | 357.44 g/mol |
| Exact Mass | 357.11 |
| IUPAC Name | 2-(5-ethynyl-2-methylphenyl)-1,3-thiazole-4-carboxamide;3-hydroxy-1-methylpyrrolidin-2-one |
| SMILES | C#Cc1ccc(C)c(-c2nc(C(N)=O)cs2)c1.CN1CCC(O)C1=O |
| InChI | InChI=1S/C13H10N2OS.C5H9NO2/c1-3-9-5-4-8(2)10(6-9)13-15-11(7-17-13)12(14)16;1-6-3-2-4(7)5(6)8/h1,4-7H,2H3,(H2,14,16);4,7H,2-3H2,1H3 |
| InChIKey | PWKNHIHBURLDLY-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 96.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 357.44 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-(5-ethynyl-2-methylphenyl)-1,3-thiazole-4-carboxamide;3-hydroxy-1-methylpyrrolidin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(5-ethynyl-2-methylphenyl)-1,3-thiazole-4-carboxamide;3-hydroxy-1-methylpyrrolidin-2-one?
The IUPAC name of 2-(5-ethynyl-2-methylphenyl)-1,3-thiazole-4-carboxamide;3-hydroxy-1-methylpyrrolidin-2-one (CID 145143428) is 2-(5-ethynyl-2-methylphenyl)-1,3-thiazole-4-carboxamide;3-hydroxy-1-methylpyrrolidin-2-one.
What is the SMILES notation for 2-(5-ethynyl-2-methylphenyl)-1,3-thiazole-4-carboxamide;3-hydroxy-1-methylpyrrolidin-2-one?
The canonical SMILES for 2-(5-ethynyl-2-methylphenyl)-1,3-thiazole-4-carboxamide;3-hydroxy-1-methylpyrrolidin-2-one is C#Cc1ccc(C)c(-c2nc(C(N)=O)cs2)c1.CN1CCC(O)C1=O.
What is the InChIKey of 2-(5-ethynyl-2-methylphenyl)-1,3-thiazole-4-carboxamide;3-hydroxy-1-methylpyrrolidin-2-one?
The InChIKey is PWKNHIHBURLDLY-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H10N2OS.C5H9NO2/c1-3-9-5-4-8(2)10(6-9)13-15-11(7-17-13)12(14)16;1-6-3-2-4(7)5(6)8/h1,4-7H,2H3,(H2,14,16);4,7H,2-3H2,1H3.
What are the key properties of 2-(5-ethynyl-2-methylphenyl)-1,3-thiazole-4-carboxamide;3-hydroxy-1-methylpyrrolidin-2-one?
2-(5-ethynyl-2-methylphenyl)-1,3-thiazole-4-carboxamide;3-hydroxy-1-methylpyrrolidin-2-one has a molecular weight of 357.44 g/mol, XLogP of 1.41, 2 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(5-ethynyl-2-methylphenyl)-1,3-thiazole-4-carboxamide;3-hydroxy-1-methylpyrrolidin-2-one is sourced from PubChem (CID 145143428), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).