About 5-[(E)-1-fluorobut-1-enyl]-4,6-dimethylpyrimidine
5-[(E)-1-fluorobut-1-enyl]-4,6-dimethylpyrimidine (PubChem CID 145143512) has the molecular formula C10H13FN2
and a molecular weight of 180.23 g/mol. Its IUPAC name is 5-[(E)-1-fluorobut-1-enyl]-4,6-dimethylpyrimidine.
Molecular Properties
| Compound Name | 5-[(E)-1-fluorobut-1-enyl]-4,6-dimethylpyrimidine |
| PubChem CID | 145143512 |
| Molecular Formula | C10H13FN2 |
| Molecular Weight | 180.23 g/mol |
| Exact Mass | 180.11 |
| IUPAC Name | 5-[(E)-1-fluorobut-1-enyl]-4,6-dimethylpyrimidine |
| SMILES | CC/C=C(/F)c1c(C)ncnc1C |
| InChI | InChI=1S/C10H13FN2/c1-4-5-9(11)10-7(2)12-6-13-8(10)3/h5-6H,4H2,1-3H3/b9-5+ |
| InChIKey | XKXAESYKXDZLJR-WEVVVXLNSA-N |
| XLogP | 2.81 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 180.23 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 5-[(E)-1-fluorobut-1-enyl]-4,6-dimethylpyrimidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[(E)-1-fluorobut-1-enyl]-4,6-dimethylpyrimidine?
The IUPAC name of 5-[(E)-1-fluorobut-1-enyl]-4,6-dimethylpyrimidine (CID 145143512) is 5-[(E)-1-fluorobut-1-enyl]-4,6-dimethylpyrimidine.
What is the SMILES notation for 5-[(E)-1-fluorobut-1-enyl]-4,6-dimethylpyrimidine?
The canonical SMILES for 5-[(E)-1-fluorobut-1-enyl]-4,6-dimethylpyrimidine is CC/C=C(/F)c1c(C)ncnc1C.
What is the InChIKey of 5-[(E)-1-fluorobut-1-enyl]-4,6-dimethylpyrimidine?
The InChIKey is XKXAESYKXDZLJR-WEVVVXLNSA-N. The full InChI is InChI=1S/C10H13FN2/c1-4-5-9(11)10-7(2)12-6-13-8(10)3/h5-6H,4H2,1-3H3/b9-5+.
What are the key properties of 5-[(E)-1-fluorobut-1-enyl]-4,6-dimethylpyrimidine?
5-[(E)-1-fluorobut-1-enyl]-4,6-dimethylpyrimidine has a molecular weight of 180.23 g/mol, XLogP of 2.81, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[(E)-1-fluorobut-1-enyl]-4,6-dimethylpyrimidine is sourced from PubChem (CID 145143512), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).