C8H11FN2 — CID 145143523
[2-(ethylideneamino)-5-fluorocyclopenta-1,4-dien-1-yl]methanamine (PubChem CID 145143523) has the molecular formula C8H11FN2 and a molecular weight of 154.19 g/mol. Its IUPAC name is [2-(ethylideneamino)-5-fluorocyclopenta-1,4-dien-1-yl]methanamine.
| Compound Name | [2-(ethylideneamino)-5-fluorocyclopenta-1,4-dien-1-yl]methanamine |
|---|---|
| PubChem CID | 145143523 |
| Molecular Formula | C8H11FN2 |
| Molecular Weight | 154.19 g/mol |
| Exact Mass | 154.09 |
| IUPAC Name | [2-(ethylideneamino)-5-fluorocyclopenta-1,4-dien-1-yl]methanamine |
| SMILES | C/C=N/C1=C(CN)C(F)=CC1 |
| InChI | InChI=1S/C8H11FN2/c1-2-11-8-4-3-7(9)6(8)5-10/h2-3H,4-5,10H2,1H3/b11-2+ |
| InChIKey | WMGRAZLEIRXNOU-BIIKFXOESA-N |
| XLogP | 1.55 |
| TPSA | 38.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 154.19 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|