C15H23N3O3 — CID 145143628
(2S,3R,4S,5S)-5-[(1S)-1-hydroxyethyl]-2,4-dimethyloxolan-3-ol;4-methyl-7H-pyrrolo[2,3-d]pyrimidine (PubChem CID 145143628) has the molecular formula C15H23N3O3 and a molecular weight of 293.37 g/mol. Its IUPAC name is (2S,3R,4S,5S)-5-[(1S)-1-hydroxyethyl]-2,4-dimethyloxolan-3-ol;4-methyl-7H-pyrrolo[2,3-d]pyrimidine.
| Compound Name | (2S,3R,4S,5S)-5-[(1S)-1-hydroxyethyl]-2,4-dimethyloxolan-3-ol;4-methyl-7H-pyrrolo[2,3-d]pyrimidine |
|---|---|
| PubChem CID | 145143628 |
| Molecular Formula | C15H23N3O3 |
| Molecular Weight | 293.37 g/mol |
| Exact Mass | 293.17 |
| IUPAC Name | (2S,3R,4S,5S)-5-[(1S)-1-hydroxyethyl]-2,4-dimethyloxolan-3-ol;4-methyl-7H-pyrrolo[2,3-d]pyrimidine |
| SMILES | C[C@H]1[C@@H](O)[C@H](C)O[C@@H]1[C@H](C)O.Cc1ncnc2[nH]ccc12 |
| InChI | InChI=1S/C8H16O3.C7H7N3/c1-4-7(10)6(3)11-8(4)5(2)9;1-5-6-2-3-8-7(6)10-4-9-5/h4-10H,1-3H3;2-4H,1H3,(H,8,9,10)/t4-,5-,6-,7+,8-;/m0./s1 |
| InChIKey | MMIFLXCZDMAWMU-LNDRQMDSSA-N |
| XLogP | 1.42 |
| TPSA | 91.26 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.37 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |