C10H11ClN2 — CID 145143896
4-chloro-5,8-dimethyl-7,8-dihydroquinazoline (PubChem CID 145143896) has the molecular formula C10H11ClN2 and a molecular weight of 194.66 g/mol. Its IUPAC name is 4-chloro-5,8-dimethyl-7,8-dihydroquinazoline.
| Compound Name | 4-chloro-5,8-dimethyl-7,8-dihydroquinazoline |
|---|---|
| PubChem CID | 145143896 |
| Molecular Formula | C10H11ClN2 |
| Molecular Weight | 194.66 g/mol |
| Exact Mass | 194.06 |
| IUPAC Name | 4-chloro-5,8-dimethyl-7,8-dihydroquinazoline |
| SMILES | CC1=CCC(C)c2ncnc(Cl)c21 |
| InChI | InChI=1S/C10H11ClN2/c1-6-3-4-7(2)9-8(6)10(11)13-5-12-9/h3,5,7H,4H2,1-2H3 |
| InChIKey | XNRGTZNIOUXNKA-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.66 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |