About N-(3-aminopropyl)formamide;7-butylimino-9,9-dimethylanthracen-2-amine
N-(3-aminopropyl)formamide;7-butylimino-9,9-dimethylanthracen-2-amine (PubChem CID 145144138) has the molecular formula C24H34N4O
and a molecular weight of 394.56 g/mol. Its IUPAC name is N-(3-aminopropyl)formamide;7-butylimino-9,9-dimethylanthracen-2-amine.
Molecular Properties
| Compound Name | N-(3-aminopropyl)formamide;7-butylimino-9,9-dimethylanthracen-2-amine |
| PubChem CID | 145144138 |
| Molecular Formula | C24H34N4O |
| Molecular Weight | 394.56 g/mol |
| Exact Mass | 394.27 |
| IUPAC Name | N-(3-aminopropyl)formamide;7-butylimino-9,9-dimethylanthracen-2-amine |
| SMILES | CCCC/N=C1\C=CC2=Cc3ccc(N)cc3C(C)(C)C2=C1.NCCCNC=O |
| InChI | InChI=1S/C20H24N2.C4H10N2O/c1-4-5-10-22-17-9-7-15-11-14-6-8-16(21)12-18(14)20(2,3)19(15)13-17;5-2-1-3-6-4-7/h6-9,11-13H,4-5,10,21H2,1-3H3;4H,1-3,5H2,(H,6,7)/b22-17+; |
| InChIKey | CQBKHKGDTIEPDD-GDHRODDYSA-N |
| XLogP | 3.76 |
| TPSA | 93.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 394.56 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'ene_quin_methide(10)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze N-(3-aminopropyl)formamide;7-butylimino-9,9-dimethylanthracen-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(3-aminopropyl)formamide;7-butylimino-9,9-dimethylanthracen-2-amine?
The IUPAC name of N-(3-aminopropyl)formamide;7-butylimino-9,9-dimethylanthracen-2-amine (CID 145144138) is N-(3-aminopropyl)formamide;7-butylimino-9,9-dimethylanthracen-2-amine.
What is the SMILES notation for N-(3-aminopropyl)formamide;7-butylimino-9,9-dimethylanthracen-2-amine?
The canonical SMILES for N-(3-aminopropyl)formamide;7-butylimino-9,9-dimethylanthracen-2-amine is CCCC/N=C1\C=CC2=Cc3ccc(N)cc3C(C)(C)C2=C1.NCCCNC=O.
What is the InChIKey of N-(3-aminopropyl)formamide;7-butylimino-9,9-dimethylanthracen-2-amine?
The InChIKey is CQBKHKGDTIEPDD-GDHRODDYSA-N. The full InChI is InChI=1S/C20H24N2.C4H10N2O/c1-4-5-10-22-17-9-7-15-11-14-6-8-16(21)12-18(14)20(2,3)19(15)13-17;5-2-1-3-6-4-7/h6-9,11-13H,4-5,10,21H2,1-3H3;4H,1-3,5H2,(H,6,7)/b22-17+;.
What are the key properties of N-(3-aminopropyl)formamide;7-butylimino-9,9-dimethylanthracen-2-amine?
N-(3-aminopropyl)formamide;7-butylimino-9,9-dimethylanthracen-2-amine has a molecular weight of 394.56 g/mol, XLogP of 3.76, 7 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-(3-aminopropyl)formamide;7-butylimino-9,9-dimethylanthracen-2-amine is sourced from PubChem (CID 145144138), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).