C20H15N5O8S3 — CID 145144484
3-[[2-amino-4-(4-methylphenyl)-1,3-thiazol-5-yl]diazenyl]-7-nitronaphthalene-1,5-disulfonic acid (PubChem CID 145144484) has the molecular formula C20H15N5O8S3 and a molecular weight of 549.57 g/mol. Its IUPAC name is 3-[[2-amino-4-(4-methylphenyl)-1,3-thiazol-5-yl]diazenyl]-7-nitronaphthalene-1,5-disulfonic acid.
| Compound Name | 3-[[2-amino-4-(4-methylphenyl)-1,3-thiazol-5-yl]diazenyl]-7-nitronaphthalene-1,5-disulfonic acid |
|---|---|
| PubChem CID | 145144484 |
| Molecular Formula | C20H15N5O8S3 |
| Molecular Weight | 549.57 g/mol |
| Exact Mass | 549.01 |
| IUPAC Name | 3-[[2-amino-4-(4-methylphenyl)-1,3-thiazol-5-yl]diazenyl]-7-nitronaphthalene-1,5-disulfonic acid |
| SMILES | Cc1ccc(-c2nc(N)sc2/N=N/c2cc(S(=O)(=O)O)c3cc([N+](=O)[O-])cc(S(=O)(=O)O)c3c2)cc1 |
| InChI | InChI=1S/C20H15N5O8S3/c1-10-2-4-11(5-3-10)18-19(34-20(21)22-18)24-23-12-6-14-15(16(7-12)35(28,29)30)8-13(25(26)27)9-17(14)36(31,32)33/h2-9H,1H3,(H2,21,22)(H,28,29,30)(H,31,32,33)/b24-23+ |
| InChIKey | PYCSYSOODVBNDO-WCWDXBQESA-N |
| XLogP | 4.67 |
| TPSA | 215.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.57 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|