C30H36F4O3S — CID 145144487
1,2,4,5-tetrafluoro-3-hydroperoxysulfanyl-6-(2,4,6-tricyclohexylphenoxy)benzene (PubChem CID 145144487) has the molecular formula C30H36F4O3S and a molecular weight of 552.67 g/mol. Its IUPAC name is 1,2,4,5-tetrafluoro-3-hydroperoxysulfanyl-6-(2,4,6-tricyclohexylphenoxy)benzene.
| Compound Name | 1,2,4,5-tetrafluoro-3-hydroperoxysulfanyl-6-(2,4,6-tricyclohexylphenoxy)benzene |
|---|---|
| PubChem CID | 145144487 |
| Molecular Formula | C30H36F4O3S |
| Molecular Weight | 552.67 g/mol |
| Exact Mass | 552.23 |
| IUPAC Name | 1,2,4,5-tetrafluoro-3-hydroperoxysulfanyl-6-(2,4,6-tricyclohexylphenoxy)benzene |
| SMILES | OOSc1c(F)c(F)c(Oc2c(C3CCCCC3)cc(C3CCCCC3)cc2C2CCCCC2)c(F)c1F |
| InChI | InChI=1S/C30H36F4O3S/c31-24-26(33)30(38-37-35)27(34)25(32)29(24)36-28-22(19-12-6-2-7-13-19)16-21(18-10-4-1-5-11-18)17-23(28)20-14-8-3-9-15-20/h16-20,35H,1-15H2 |
| InChIKey | JVTCZOUIKKWHAL-UHFFFAOYSA-N |
| XLogP | 10.68 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.67 |
| LogP ≤ 5 | 10.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|