C24H24FNO2 — CID 145145074
5-[4-fluoro-2-(methoxymethyl)phenyl]-2-[[(2E,4Z)-hepta-2,4,6-trien-2-yl]oxymethyl]-3aH-indole (PubChem CID 145145074) has the molecular formula C24H24FNO2 and a molecular weight of 377.46 g/mol. Its IUPAC name is 5-[4-fluoro-2-(methoxymethyl)phenyl]-2-[[(2E,4Z)-hepta-2,4,6-trien-2-yl]oxymethyl]-3aH-indole.
| Compound Name | 5-[4-fluoro-2-(methoxymethyl)phenyl]-2-[[(2E,4Z)-hepta-2,4,6-trien-2-yl]oxymethyl]-3aH-indole |
|---|---|
| PubChem CID | 145145074 |
| Molecular Formula | C24H24FNO2 |
| Molecular Weight | 377.46 g/mol |
| Exact Mass | 377.18 |
| IUPAC Name | 5-[4-fluoro-2-(methoxymethyl)phenyl]-2-[[(2E,4Z)-hepta-2,4,6-trien-2-yl]oxymethyl]-3aH-indole |
| SMILES | C=C/C=C\C=C(/C)OCC1=CC2C=C(c3ccc(F)cc3COC)C=CC2=N1 |
| InChI | InChI=1S/C24H24FNO2/c1-4-5-6-7-17(2)28-16-22-14-19-12-18(8-11-24(19)26-22)23-10-9-21(25)13-20(23)15-27-3/h4-14,19H,1,15-16H2,2-3H3/b6-5-,17-7+ |
| InChIKey | PXCQUCYFCXPNPO-IANWOCAHSA-N |
| XLogP | 5.54 |
| TPSA | 30.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.46 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|