C21H37NO4 — CID 14514528
1-O-tert-butyl 2-O-octyl (2S,3aS,6aS)-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]pyrrole-1,2-dicarboxylate (PubChem CID 14514528) has the molecular formula C21H37NO4 and a molecular weight of 367.53 g/mol. Its IUPAC name is 1-O-tert-butyl 2-O-octyl (2S,3aS,6aS)-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]pyrrole-1,2-dicarboxylate.
| Compound Name | 1-O-tert-butyl 2-O-octyl (2S,3aS,6aS)-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]pyrrole-1,2-dicarboxylate |
|---|---|
| PubChem CID | 14514528 |
| Molecular Formula | C21H37NO4 |
| Molecular Weight | 367.53 g/mol |
| Exact Mass | 367.27 |
| IUPAC Name | 1-O-tert-butyl 2-O-octyl (2S,3aS,6aS)-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]pyrrole-1,2-dicarboxylate |
| SMILES | CCCCCCCCOC(=O)[C@@H]1C[C@@H]2CCC[C@@H]2N1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C21H37NO4/c1-5-6-7-8-9-10-14-25-19(23)18-15-16-12-11-13-17(16)22(18)20(24)26-21(2,3)4/h16-18H,5-15H2,1-4H3/t16-,17-,18-/m0/s1 |
| InChIKey | LXVBQKSHGLKVOE-BZSNNMDCSA-N |
| XLogP | 5.07 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.53 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|