About 1-cyclopropylsulfinyl-2,4-dimethylpiperazine
1-cyclopropylsulfinyl-2,4-dimethylpiperazine (PubChem CID 145145542) has the molecular formula C9H18N2OS
and a molecular weight of 202.32 g/mol. Its IUPAC name is 1-cyclopropylsulfinyl-2,4-dimethylpiperazine.
Molecular Properties
| Compound Name | 1-cyclopropylsulfinyl-2,4-dimethylpiperazine |
| PubChem CID | 145145542 |
| Molecular Formula | C9H18N2OS |
| Molecular Weight | 202.32 g/mol |
| Exact Mass | 202.11 |
| IUPAC Name | 1-cyclopropylsulfinyl-2,4-dimethylpiperazine |
| SMILES | CC1CN(C)CCN1S(=O)C1CC1 |
| InChI | InChI=1S/C9H18N2OS/c1-8-7-10(2)5-6-11(8)13(12)9-3-4-9/h8-9H,3-7H2,1-2H3 |
| InChIKey | HOQWBSJNIXWPSY-UHFFFAOYSA-N |
| XLogP | 0.45 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 202.32 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-cyclopropylsulfinyl-2,4-dimethylpiperazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-cyclopropylsulfinyl-2,4-dimethylpiperazine?
The IUPAC name of 1-cyclopropylsulfinyl-2,4-dimethylpiperazine (CID 145145542) is 1-cyclopropylsulfinyl-2,4-dimethylpiperazine.
What is the SMILES notation for 1-cyclopropylsulfinyl-2,4-dimethylpiperazine?
The canonical SMILES for 1-cyclopropylsulfinyl-2,4-dimethylpiperazine is CC1CN(C)CCN1S(=O)C1CC1.
What is the InChIKey of 1-cyclopropylsulfinyl-2,4-dimethylpiperazine?
The InChIKey is HOQWBSJNIXWPSY-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H18N2OS/c1-8-7-10(2)5-6-11(8)13(12)9-3-4-9/h8-9H,3-7H2,1-2H3.
What are the key properties of 1-cyclopropylsulfinyl-2,4-dimethylpiperazine?
1-cyclopropylsulfinyl-2,4-dimethylpiperazine has a molecular weight of 202.32 g/mol, XLogP of 0.45, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-cyclopropylsulfinyl-2,4-dimethylpiperazine is sourced from PubChem (CID 145145542), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).