C23H29N5O2 — CID 145145627
1-[2-benzyl-4-[(3Z)-1,1,4-triamino-4-(2-hydroxyphenyl)buta-1,3-dien-2-yl]piperazin-1-yl]ethanone (PubChem CID 145145627) has the molecular formula C23H29N5O2 and a molecular weight of 407.52 g/mol. Its IUPAC name is 1-[2-benzyl-4-[(3Z)-1,1,4-triamino-4-(2-hydroxyphenyl)buta-1,3-dien-2-yl]piperazin-1-yl]ethanone.
| Compound Name | 1-[2-benzyl-4-[(3Z)-1,1,4-triamino-4-(2-hydroxyphenyl)buta-1,3-dien-2-yl]piperazin-1-yl]ethanone |
|---|---|
| PubChem CID | 145145627 |
| Molecular Formula | C23H29N5O2 |
| Molecular Weight | 407.52 g/mol |
| Exact Mass | 407.23 |
| IUPAC Name | 1-[2-benzyl-4-[(3Z)-1,1,4-triamino-4-(2-hydroxyphenyl)buta-1,3-dien-2-yl]piperazin-1-yl]ethanone |
| SMILES | CC(=O)N1CCN(C(/C=C(\N)c2ccccc2O)=C(N)N)CC1Cc1ccccc1 |
| InChI | InChI=1S/C23H29N5O2/c1-16(29)28-12-11-27(15-18(28)13-17-7-3-2-4-8-17)21(23(25)26)14-20(24)19-9-5-6-10-22(19)30/h2-10,14,18,30H,11-13,15,24-26H2,1H3/b20-14- |
| InChIKey | SUDRRZVLUKMTPN-ZHZULCJRSA-N |
| XLogP | 1.55 |
| TPSA | 121.84 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.52 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|