C15H20F3N5O — CID 145145659
2-[(1Z)-1,4,4-triamino-3-[3-(trifluoromethyl)piperazin-1-yl]buta-1,3-dienyl]phenol (PubChem CID 145145659) has the molecular formula C15H20F3N5O and a molecular weight of 343.35 g/mol. Its IUPAC name is 2-[(1Z)-1,4,4-triamino-3-[3-(trifluoromethyl)piperazin-1-yl]buta-1,3-dienyl]phenol.
| Compound Name | 2-[(1Z)-1,4,4-triamino-3-[3-(trifluoromethyl)piperazin-1-yl]buta-1,3-dienyl]phenol |
|---|---|
| PubChem CID | 145145659 |
| Molecular Formula | C15H20F3N5O |
| Molecular Weight | 343.35 g/mol |
| Exact Mass | 343.16 |
| IUPAC Name | 2-[(1Z)-1,4,4-triamino-3-[3-(trifluoromethyl)piperazin-1-yl]buta-1,3-dienyl]phenol |
| SMILES | NC(N)=C(/C=C(\N)c1ccccc1O)N1CCNC(C(F)(F)F)C1 |
| InChI | InChI=1S/C15H20F3N5O/c16-15(17,18)13-8-23(6-5-22-13)11(14(20)21)7-10(19)9-3-1-2-4-12(9)24/h1-4,7,13,22,24H,5-6,8,19-21H2/b10-7- |
| InChIKey | VJHKJPQWZVXBAI-YFHOEESVSA-N |
| XLogP | 0.61 |
| TPSA | 113.56 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.35 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|