C33H52N2O5 — CID 14514571
octyl (2S,3aS,6aS)-1-[(2S)-2-[[(2S)-1-(2-methylpropoxy)-1-oxo-4-phenylbutan-2-yl]amino]propanoyl]-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]pyrrole-2-carboxylate (PubChem CID 14514571) has the molecular formula C33H52N2O5 and a molecular weight of 556.79 g/mol. Its IUPAC name is octyl (2S,3aS,6aS)-1-[(2S)-2-[[(2S)-1-(2-methylpropoxy)-1-oxo-4-phenylbutan-2-yl]amino]propanoyl]-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]pyrrole-2-carboxylate.
| Compound Name | octyl (2S,3aS,6aS)-1-[(2S)-2-[[(2S)-1-(2-methylpropoxy)-1-oxo-4-phenylbutan-2-yl]amino]propanoyl]-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]pyrrole-2-carboxylate |
|---|---|
| PubChem CID | 14514571 |
| Molecular Formula | C33H52N2O5 |
| Molecular Weight | 556.79 g/mol |
| Exact Mass | 556.39 |
| IUPAC Name | octyl (2S,3aS,6aS)-1-[(2S)-2-[[(2S)-1-(2-methylpropoxy)-1-oxo-4-phenylbutan-2-yl]amino]propanoyl]-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]pyrrole-2-carboxylate |
| SMILES | CCCCCCCCOC(=O)[C@@H]1C[C@@H]2CCC[C@@H]2N1C(=O)[C@H](C)N[C@@H](CCc1ccccc1)C(=O)OCC(C)C |
| InChI | InChI=1S/C33H52N2O5/c1-5-6-7-8-9-13-21-39-33(38)30-22-27-17-14-18-29(27)35(30)31(36)25(4)34-28(32(37)40-23-24(2)3)20-19-26-15-11-10-12-16-26/h10-12,15-16,24-25,27-30,34H,5-9,13-14,17-23H2,1-4H3/t25-,27-,28-,29-,30-/m0/s1 |
| InChIKey | OPVGEIPRFWAMGJ-BJNPORTCSA-N |
| XLogP | 5.84 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.79 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|