C22H29FN6O — CID 145145793
2-[(1Z)-1,4,4-triamino-3-[3-ethyl-4-(5-fluoro-2-pyridinyl)-5-methylpiperazin-1-yl]buta-1,3-dienyl]phenol (PubChem CID 145145793) has the molecular formula C22H29FN6O and a molecular weight of 412.51 g/mol. Its IUPAC name is 2-[(1Z)-1,4,4-triamino-3-[3-ethyl-4-(5-fluoro-2-pyridinyl)-5-methylpiperazin-1-yl]buta-1,3-dienyl]phenol.
| Compound Name | 2-[(1Z)-1,4,4-triamino-3-[3-ethyl-4-(5-fluoro-2-pyridinyl)-5-methylpiperazin-1-yl]buta-1,3-dienyl]phenol |
|---|---|
| PubChem CID | 145145793 |
| Molecular Formula | C22H29FN6O |
| Molecular Weight | 412.51 g/mol |
| Exact Mass | 412.24 |
| IUPAC Name | 2-[(1Z)-1,4,4-triamino-3-[3-ethyl-4-(5-fluoro-2-pyridinyl)-5-methylpiperazin-1-yl]buta-1,3-dienyl]phenol |
| SMILES | CCC1CN(C(/C=C(\N)c2ccccc2O)=C(N)N)CC(C)N1c1ccc(F)cn1 |
| InChI | InChI=1S/C22H29FN6O/c1-3-16-13-28(12-14(2)29(16)21-9-8-15(23)11-27-21)19(22(25)26)10-18(24)17-6-4-5-7-20(17)30/h4-11,14,16,30H,3,12-13,24-26H2,1-2H3/b18-10- |
| InChIKey | PYVCDDCLSCAQCL-ZDLGFXPLSA-N |
| XLogP | 2.30 |
| TPSA | 117.66 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.51 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|