C18H29N5O — CID 145145816
2-[(1Z)-1,4,4-triamino-3-[4-[(dimethylamino)methyl]piperidin-1-yl]buta-1,3-dienyl]phenol (PubChem CID 145145816) has the molecular formula C18H29N5O and a molecular weight of 331.46 g/mol. Its IUPAC name is 2-[(1Z)-1,4,4-triamino-3-[4-[(dimethylamino)methyl]piperidin-1-yl]buta-1,3-dienyl]phenol.
| Compound Name | 2-[(1Z)-1,4,4-triamino-3-[4-[(dimethylamino)methyl]piperidin-1-yl]buta-1,3-dienyl]phenol |
|---|---|
| PubChem CID | 145145816 |
| Molecular Formula | C18H29N5O |
| Molecular Weight | 331.46 g/mol |
| Exact Mass | 331.24 |
| IUPAC Name | 2-[(1Z)-1,4,4-triamino-3-[4-[(dimethylamino)methyl]piperidin-1-yl]buta-1,3-dienyl]phenol |
| SMILES | CN(C)CC1CCN(C(/C=C(\N)c2ccccc2O)=C(N)N)CC1 |
| InChI | InChI=1S/C18H29N5O/c1-22(2)12-13-7-9-23(10-8-13)16(18(20)21)11-15(19)14-5-3-4-6-17(14)24/h3-6,11,13,24H,7-10,12,19-21H2,1-2H3/b15-11- |
| InChIKey | TUGWPUIXLYPXNY-PTNGSMBKSA-N |
| XLogP | 1.05 |
| TPSA | 104.77 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.46 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|