C12H15FN2 — CID 145145972
3-ethylimino-3-(4-fluorophenyl)-N-methylprop-1-en-2-amine (PubChem CID 145145972) has the molecular formula C12H15FN2 and a molecular weight of 206.26 g/mol. Its IUPAC name is 3-ethylimino-3-(4-fluorophenyl)-N-methylprop-1-en-2-amine.
| Compound Name | 3-ethylimino-3-(4-fluorophenyl)-N-methylprop-1-en-2-amine |
|---|---|
| PubChem CID | 145145972 |
| Molecular Formula | C12H15FN2 |
| Molecular Weight | 206.26 g/mol |
| Exact Mass | 206.12 |
| IUPAC Name | 3-ethylimino-3-(4-fluorophenyl)-N-methylprop-1-en-2-amine |
| SMILES | C=C(NC)/C(=N\CC)c1ccc(F)cc1 |
| InChI | InChI=1S/C12H15FN2/c1-4-15-12(9(2)14-3)10-5-7-11(13)8-6-10/h5-8,14H,2,4H2,1,3H3/b15-12+ |
| InChIKey | NLNNADYUTGLPSE-NTCAYCPXSA-N |
| XLogP | 2.37 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.26 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|