C31H30N6O4S3 — CID 145146199
4-[4-[[2-(2-cyclopropylimidazo[2,1-b][1,3,4]thiadiazol-6-yl)-5-methoxy-1,3-benzothiazol-7-yl]oxymethyl]-1,3-thiazol-2-yl]-N-methylbenzamide;oxolane (PubChem CID 145146199) has the molecular formula C31H30N6O4S3 and a molecular weight of 646.82 g/mol. Its IUPAC name is 4-[4-[[2-(2-cyclopropylimidazo[2,1-b][1,3,4]thiadiazol-6-yl)-5-methoxy-1,3-benzothiazol-7-yl]oxymethyl]-1,3-thiazol-2-yl]-N-methylbenzamide;oxolane.
| Compound Name | 4-[4-[[2-(2-cyclopropylimidazo[2,1-b][1,3,4]thiadiazol-6-yl)-5-methoxy-1,3-benzothiazol-7-yl]oxymethyl]-1,3-thiazol-2-yl]-N-methylbenzamide;oxolane |
|---|---|
| PubChem CID | 145146199 |
| Molecular Formula | C31H30N6O4S3 |
| Molecular Weight | 646.82 g/mol |
| Exact Mass | 646.15 |
| IUPAC Name | 4-[4-[[2-(2-cyclopropylimidazo[2,1-b][1,3,4]thiadiazol-6-yl)-5-methoxy-1,3-benzothiazol-7-yl]oxymethyl]-1,3-thiazol-2-yl]-N-methylbenzamide;oxolane |
| SMILES | C1CCOC1.CNC(=O)c1ccc(-c2nc(COc3cc(OC)cc4nc(-c5cn6nc(C7CC7)sc6n5)sc34)cs2)cc1 |
| InChI | InChI=1S/C27H22N6O3S3.C4H8O/c1-28-23(34)14-3-5-15(6-4-14)24-29-17(13-37-24)12-36-21-10-18(35-2)9-19-22(21)38-26(30-19)20-11-33-27(31-20)39-25(32-33)16-7-8-16;1-2-4-5-3-1/h3-6,9-11,13,16H,7-8,12H2,1-2H3,(H,28,34);1-4H2 |
| InChIKey | ZNWBNNSKDPLTPF-UHFFFAOYSA-N |
| XLogP | 6.81 |
| TPSA | 112.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 44 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 646.82 |
| LogP ≤ 5 | 6.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |