C33H57N5O5S — CID 145146279
acetylene;[1-[4-(cyclohexylcarbamoyl)-1,3-thiazol-2-yl]-4-methyl-3-[methyl(3-methylbutanoyl)amino]pentyl] acetate;6-(methylamino)hexanamide (PubChem CID 145146279) has the molecular formula C33H57N5O5S and a molecular weight of 635.92 g/mol. Its IUPAC name is acetylene;[1-[4-(cyclohexylcarbamoyl)-1,3-thiazol-2-yl]-4-methyl-3-[methyl(3-methylbutanoyl)amino]pentyl] acetate;6-(methylamino)hexanamide.
| Compound Name | acetylene;[1-[4-(cyclohexylcarbamoyl)-1,3-thiazol-2-yl]-4-methyl-3-[methyl(3-methylbutanoyl)amino]pentyl] acetate;6-(methylamino)hexanamide |
|---|---|
| PubChem CID | 145146279 |
| Molecular Formula | C33H57N5O5S |
| Molecular Weight | 635.92 g/mol |
| Exact Mass | 635.41 |
| IUPAC Name | acetylene;[1-[4-(cyclohexylcarbamoyl)-1,3-thiazol-2-yl]-4-methyl-3-[methyl(3-methylbutanoyl)amino]pentyl] acetate;6-(methylamino)hexanamide |
| SMILES | C#C.CC(=O)OC(CC(C(C)C)N(C)C(=O)CC(C)C)c1nc(C(=O)NC2CCCCC2)cs1.CNCCCCCC(N)=O |
| InChI | InChI=1S/C24H39N3O4S.C7H16N2O.C2H2/c1-15(2)12-22(29)27(6)20(16(3)4)13-21(31-17(5)28)24-26-19(14-32-24)23(30)25-18-10-8-7-9-11-18;1-9-6-4-2-3-5-7(8)10;1-2/h14-16,18,20-21H,7-13H2,1-6H3,(H,25,30);9H,2-6H2,1H3,(H2,8,10);1-2H |
| InChIKey | LBMYQVMKLVCCBK-UHFFFAOYSA-N |
| XLogP | 5.23 |
| TPSA | 143.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 635.92 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|