C24H29ClN6O4S — CID 145146550
tert-butyl 4-chloro-5-[[5-(3-nitrophenyl)-1,3,4-thiadiazol-2-yl]amino]indazole-1-carboxylate;ethane (PubChem CID 145146550) has the molecular formula C24H29ClN6O4S and a molecular weight of 533.05 g/mol. Its IUPAC name is tert-butyl 4-chloro-5-[[5-(3-nitrophenyl)-1,3,4-thiadiazol-2-yl]amino]indazole-1-carboxylate;ethane.
| Compound Name | tert-butyl 4-chloro-5-[[5-(3-nitrophenyl)-1,3,4-thiadiazol-2-yl]amino]indazole-1-carboxylate;ethane |
|---|---|
| PubChem CID | 145146550 |
| Molecular Formula | C24H29ClN6O4S |
| Molecular Weight | 533.05 g/mol |
| Exact Mass | 532.17 |
| IUPAC Name | tert-butyl 4-chloro-5-[[5-(3-nitrophenyl)-1,3,4-thiadiazol-2-yl]amino]indazole-1-carboxylate;ethane |
| SMILES | CC.CC.CC(C)(C)OC(=O)n1ncc2c(Cl)c(Nc3nnc(-c4cccc([N+](=O)[O-])c4)s3)ccc21 |
| InChI | InChI=1S/C20H17ClN6O4S.2C2H6/c1-20(2,3)31-19(28)26-15-8-7-14(16(21)13(15)10-22-26)23-18-25-24-17(32-18)11-5-4-6-12(9-11)27(29)30;2*1-2/h4-10H,1-3H3,(H,23,25);2*1-2H3 |
| InChIKey | QCEFIKAGDKLXQK-UHFFFAOYSA-N |
| XLogP | 7.70 |
| TPSA | 125.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.05 |
| LogP ≤ 5 | 7.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|