C17H16N6O2S — CID 145146563
ethane;N-(1H-indazol-5-yl)-5-(3-nitrophenyl)-1,3,4-thiadiazol-2-amine (PubChem CID 145146563) has the molecular formula C17H16N6O2S and a molecular weight of 368.42 g/mol. Its IUPAC name is ethane;N-(1H-indazol-5-yl)-5-(3-nitrophenyl)-1,3,4-thiadiazol-2-amine.
| Compound Name | ethane;N-(1H-indazol-5-yl)-5-(3-nitrophenyl)-1,3,4-thiadiazol-2-amine |
|---|---|
| PubChem CID | 145146563 |
| Molecular Formula | C17H16N6O2S |
| Molecular Weight | 368.42 g/mol |
| Exact Mass | 368.11 |
| IUPAC Name | ethane;N-(1H-indazol-5-yl)-5-(3-nitrophenyl)-1,3,4-thiadiazol-2-amine |
| SMILES | CC.O=[N+]([O-])c1cccc(-c2nnc(Nc3ccc4[nH]ncc4c3)s2)c1 |
| InChI | InChI=1S/C15H10N6O2S.C2H6/c22-21(23)12-3-1-2-9(7-12)14-19-20-15(24-14)17-11-4-5-13-10(6-11)8-16-18-13;1-2/h1-8H,(H,16,18)(H,17,20);1-2H3 |
| InChIKey | IMDLRGLJZDXXBO-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 109.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.42 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|