C25H27ClN6O6S — CID 145146570
tert-butyl 5-[[butoxy(hydroxy)methyl]-[5-(3-nitrophenyl)-1,3,4-thiadiazol-2-yl]amino]-4-chloroindazole-1-carboxylate (PubChem CID 145146570) has the molecular formula C25H27ClN6O6S and a molecular weight of 575.05 g/mol. Its IUPAC name is tert-butyl 5-[[butoxy(hydroxy)methyl]-[5-(3-nitrophenyl)-1,3,4-thiadiazol-2-yl]amino]-4-chloroindazole-1-carboxylate.
| Compound Name | tert-butyl 5-[[butoxy(hydroxy)methyl]-[5-(3-nitrophenyl)-1,3,4-thiadiazol-2-yl]amino]-4-chloroindazole-1-carboxylate |
|---|---|
| PubChem CID | 145146570 |
| Molecular Formula | C25H27ClN6O6S |
| Molecular Weight | 575.05 g/mol |
| Exact Mass | 574.14 |
| IUPAC Name | tert-butyl 5-[[butoxy(hydroxy)methyl]-[5-(3-nitrophenyl)-1,3,4-thiadiazol-2-yl]amino]-4-chloroindazole-1-carboxylate |
| SMILES | CCCCOC(O)N(c1nnc(-c2cccc([N+](=O)[O-])c2)s1)c1ccc2c(cnn2C(=O)OC(C)(C)C)c1Cl |
| InChI | InChI=1S/C25H27ClN6O6S/c1-5-6-12-37-23(33)30(22-29-28-21(39-22)15-8-7-9-16(13-15)32(35)36)19-11-10-18-17(20(19)26)14-27-31(18)24(34)38-25(2,3)4/h7-11,13-14,23,33H,5-6,12H2,1-4H3 |
| InChIKey | AJYCRBAKCFGIKF-UHFFFAOYSA-N |
| XLogP | 6.13 |
| TPSA | 145.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.05 |
| LogP ≤ 5 | 6.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|