C26H31ClN6O4S — CID 145146591
tert-butyl 5-[[5-[(2E,4E)-5-aminohepta-2,4,6-trien-3-yl]-1,3,4-thiadiazol-2-yl]-[(2-methylpropan-2-yl)oxycarbonyl]amino]-4-chloroindazole-1-carboxylate (PubChem CID 145146591) has the molecular formula C26H31ClN6O4S and a molecular weight of 559.09 g/mol. Its IUPAC name is tert-butyl 5-[[5-[(2E,4E)-5-aminohepta-2,4,6-trien-3-yl]-1,3,4-thiadiazol-2-yl]-[(2-methylpropan-2-yl)oxycarbonyl]amino]-4-chloroindazole-1-carboxylate.
| Compound Name | tert-butyl 5-[[5-[(2E,4E)-5-aminohepta-2,4,6-trien-3-yl]-1,3,4-thiadiazol-2-yl]-[(2-methylpropan-2-yl)oxycarbonyl]amino]-4-chloroindazole-1-carboxylate |
|---|---|
| PubChem CID | 145146591 |
| Molecular Formula | C26H31ClN6O4S |
| Molecular Weight | 559.09 g/mol |
| Exact Mass | 558.18 |
| IUPAC Name | tert-butyl 5-[[5-[(2E,4E)-5-aminohepta-2,4,6-trien-3-yl]-1,3,4-thiadiazol-2-yl]-[(2-methylpropan-2-yl)oxycarbonyl]amino]-4-chloroindazole-1-carboxylate |
| SMILES | C=C/C(N)=C\C(=C/C)c1nnc(N(C(=O)OC(C)(C)C)c2ccc3c(cnn3C(=O)OC(C)(C)C)c2Cl)s1 |
| InChI | InChI=1S/C26H31ClN6O4S/c1-9-15(13-16(28)10-2)21-30-31-22(38-21)32(23(34)36-25(3,4)5)19-12-11-18-17(20(19)27)14-29-33(18)24(35)37-26(6,7)8/h9-14H,2,28H2,1,3-8H3/b15-9+,16-13+ |
| InChIKey | OUNIJXOHCSXFKB-RNPYNJAESA-N |
| XLogP | 6.83 |
| TPSA | 125.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.09 |
| LogP ≤ 5 | 6.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|