C27H33N7O4S2 — CID 145146600
tert-butyl 5-[[5-[3-(2-aminoethylsulfanylamino)phenyl]-1,3,4-thiadiazol-2-yl]-[(2-methylpropan-2-yl)oxycarbonyl]amino]indazole-1-carboxylate (PubChem CID 145146600) has the molecular formula C27H33N7O4S2 and a molecular weight of 583.74 g/mol. Its IUPAC name is tert-butyl 5-[[5-[3-(2-aminoethylsulfanylamino)phenyl]-1,3,4-thiadiazol-2-yl]-[(2-methylpropan-2-yl)oxycarbonyl]amino]indazole-1-carboxylate.
| Compound Name | tert-butyl 5-[[5-[3-(2-aminoethylsulfanylamino)phenyl]-1,3,4-thiadiazol-2-yl]-[(2-methylpropan-2-yl)oxycarbonyl]amino]indazole-1-carboxylate |
|---|---|
| PubChem CID | 145146600 |
| Molecular Formula | C27H33N7O4S2 |
| Molecular Weight | 583.74 g/mol |
| Exact Mass | 583.20 |
| IUPAC Name | tert-butyl 5-[[5-[3-(2-aminoethylsulfanylamino)phenyl]-1,3,4-thiadiazol-2-yl]-[(2-methylpropan-2-yl)oxycarbonyl]amino]indazole-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N(c1ccc2c(cnn2C(=O)OC(C)(C)C)c1)c1nnc(-c2cccc(NSCCN)c2)s1 |
| InChI | InChI=1S/C27H33N7O4S2/c1-26(2,3)37-24(35)33(20-10-11-21-18(15-20)16-29-34(21)25(36)38-27(4,5)6)23-31-30-22(40-23)17-8-7-9-19(14-17)32-39-13-12-28/h7-11,14-16,32H,12-13,28H2,1-6H3 |
| InChIKey | MKCMIQZHLJXZEL-UHFFFAOYSA-N |
| XLogP | 6.43 |
| TPSA | 137.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 583.74 |
| LogP ≤ 5 | 6.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|