C14H13F2N5O — CID 145146664
2-(2,6-difluorophenyl)-4-(2-ethylhydrazinyl)-6,7-dihydropyrrolo[3,4-d]pyrimidin-5-one (PubChem CID 145146664) has the molecular formula C14H13F2N5O and a molecular weight of 305.29 g/mol. Its IUPAC name is 2-(2,6-difluorophenyl)-4-(2-ethylhydrazinyl)-6,7-dihydropyrrolo[3,4-d]pyrimidin-5-one.
| Compound Name | 2-(2,6-difluorophenyl)-4-(2-ethylhydrazinyl)-6,7-dihydropyrrolo[3,4-d]pyrimidin-5-one |
|---|---|
| PubChem CID | 145146664 |
| Molecular Formula | C14H13F2N5O |
| Molecular Weight | 305.29 g/mol |
| Exact Mass | 305.11 |
| IUPAC Name | 2-(2,6-difluorophenyl)-4-(2-ethylhydrazinyl)-6,7-dihydropyrrolo[3,4-d]pyrimidin-5-one |
| SMILES | CCNNc1nc(-c2c(F)cccc2F)nc2c1C(=O)NC2 |
| InChI | InChI=1S/C14H13F2N5O/c1-2-18-21-13-11-9(6-17-14(11)22)19-12(20-13)10-7(15)4-3-5-8(10)16/h3-5,18H,2,6H2,1H3,(H,17,22)(H,19,20,21) |
| InChIKey | PBJUFHQENVAFNQ-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 78.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.29 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|