C17H31F3N6O3 — CID 145147069
N-[2-[[6-methyl-2-[[4-(trifluoromethoxy)cyclohexyl]carbamoylamino]-1,3-diazinan-4-yl]amino]ethyl]acetamide (PubChem CID 145147069) has the molecular formula C17H31F3N6O3 and a molecular weight of 424.47 g/mol. Its IUPAC name is N-[2-[[6-methyl-2-[[4-(trifluoromethoxy)cyclohexyl]carbamoylamino]-1,3-diazinan-4-yl]amino]ethyl]acetamide.
| Compound Name | N-[2-[[6-methyl-2-[[4-(trifluoromethoxy)cyclohexyl]carbamoylamino]-1,3-diazinan-4-yl]amino]ethyl]acetamide |
|---|---|
| PubChem CID | 145147069 |
| Molecular Formula | C17H31F3N6O3 |
| Molecular Weight | 424.47 g/mol |
| Exact Mass | 424.24 |
| IUPAC Name | N-[2-[[6-methyl-2-[[4-(trifluoromethoxy)cyclohexyl]carbamoylamino]-1,3-diazinan-4-yl]amino]ethyl]acetamide |
| SMILES | CC(=O)NCCNC1CC(C)NC(NC(=O)NC2CCC(OC(F)(F)F)CC2)N1 |
| InChI | InChI=1S/C17H31F3N6O3/c1-10-9-14(22-8-7-21-11(2)27)25-15(23-10)26-16(28)24-12-3-5-13(6-4-12)29-17(18,19)20/h10,12-15,22-23,25H,3-9H2,1-2H3,(H,21,27)(H2,24,26,28) |
| InChIKey | BFZPNQMPIQLRNO-UHFFFAOYSA-N |
| XLogP | 0.44 |
| TPSA | 115.55 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.47 |
| LogP ≤ 5 | 0.44 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|