C22H28N4O4 — CID 14514743
1-(4-nitrophenyl)-3-[3-[3-(piperidin-1-ylmethyl)phenoxy]propyl]urea (PubChem CID 14514743) has the molecular formula C22H28N4O4 and a molecular weight of 412.49 g/mol. Its IUPAC name is 1-(4-nitrophenyl)-3-[3-[3-(piperidin-1-ylmethyl)phenoxy]propyl]urea.
| Compound Name | 1-(4-nitrophenyl)-3-[3-[3-(piperidin-1-ylmethyl)phenoxy]propyl]urea |
|---|---|
| PubChem CID | 14514743 |
| Molecular Formula | C22H28N4O4 |
| Molecular Weight | 412.49 g/mol |
| Exact Mass | 412.21 |
| IUPAC Name | 1-(4-nitrophenyl)-3-[3-[3-(piperidin-1-ylmethyl)phenoxy]propyl]urea |
| SMILES | O=C(NCCCOc1cccc(CN2CCCCC2)c1)Nc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C22H28N4O4/c27-22(24-19-8-10-20(11-9-19)26(28)29)23-12-5-15-30-21-7-4-6-18(16-21)17-25-13-2-1-3-14-25/h4,6-11,16H,1-3,5,12-15,17H2,(H2,23,24,27) |
| InChIKey | CMMPYSSGZCXFRL-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 96.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.49 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|