About 2-[(Z)-but-1-enyl]-1,3-difluorobenzene;ethane
2-[(Z)-but-1-enyl]-1,3-difluorobenzene;ethane (PubChem CID 145147659) has the molecular formula C12H16F2
and a molecular weight of 198.26 g/mol. Its IUPAC name is 2-[(Z)-but-1-enyl]-1,3-difluorobenzene;ethane.
Molecular Properties
| Compound Name | 2-[(Z)-but-1-enyl]-1,3-difluorobenzene;ethane |
| PubChem CID | 145147659 |
| Molecular Formula | C12H16F2 |
| Molecular Weight | 198.26 g/mol |
| Exact Mass | 198.12 |
| IUPAC Name | 2-[(Z)-but-1-enyl]-1,3-difluorobenzene;ethane |
| SMILES | CC.CC/C=C\c1c(F)cccc1F |
| InChI | InChI=1S/C10H10F2.C2H6/c1-2-3-5-8-9(11)6-4-7-10(8)12;1-2/h3-7H,2H2,1H3;1-2H3/b5-3-; |
| InChIKey | YSYAVVCIDCKFKJ-FBZPGIPVSA-N |
| XLogP | 4.41 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 198.26 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 2-[(Z)-but-1-enyl]-1,3-difluorobenzene;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(Z)-but-1-enyl]-1,3-difluorobenzene;ethane?
The IUPAC name of 2-[(Z)-but-1-enyl]-1,3-difluorobenzene;ethane (CID 145147659) is 2-[(Z)-but-1-enyl]-1,3-difluorobenzene;ethane.
What is the SMILES notation for 2-[(Z)-but-1-enyl]-1,3-difluorobenzene;ethane?
The canonical SMILES for 2-[(Z)-but-1-enyl]-1,3-difluorobenzene;ethane is CC.CC/C=C\c1c(F)cccc1F.
What is the InChIKey of 2-[(Z)-but-1-enyl]-1,3-difluorobenzene;ethane?
The InChIKey is YSYAVVCIDCKFKJ-FBZPGIPVSA-N. The full InChI is InChI=1S/C10H10F2.C2H6/c1-2-3-5-8-9(11)6-4-7-10(8)12;1-2/h3-7H,2H2,1H3;1-2H3/b5-3-;.
What are the key properties of 2-[(Z)-but-1-enyl]-1,3-difluorobenzene;ethane?
2-[(Z)-but-1-enyl]-1,3-difluorobenzene;ethane has a molecular weight of 198.26 g/mol, XLogP of 4.41, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(Z)-but-1-enyl]-1,3-difluorobenzene;ethane is sourced from PubChem (CID 145147659), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).