C22H20F4N4O3S — CID 145147813
(3R)-3-amino-5-[(4-cyanophenyl)methyl]-8-fluoro-1,4-dioxo-N-(4,4,4-trifluorobutyl)-2,3-dihydro-1λ4,5-benzothiazepine-7-carboxamide (PubChem CID 145147813) has the molecular formula C22H20F4N4O3S and a molecular weight of 496.49 g/mol. Its IUPAC name is (3R)-3-amino-5-[(4-cyanophenyl)methyl]-8-fluoro-1,4-dioxo-N-(4,4,4-trifluorobutyl)-2,3-dihydro-1λ4,5-benzothiazepine-7-carboxamide.
| Compound Name | (3R)-3-amino-5-[(4-cyanophenyl)methyl]-8-fluoro-1,4-dioxo-N-(4,4,4-trifluorobutyl)-2,3-dihydro-1λ4,5-benzothiazepine-7-carboxamide |
|---|---|
| PubChem CID | 145147813 |
| Molecular Formula | C22H20F4N4O3S |
| Molecular Weight | 496.49 g/mol |
| Exact Mass | 496.12 |
| IUPAC Name | (3R)-3-amino-5-[(4-cyanophenyl)methyl]-8-fluoro-1,4-dioxo-N-(4,4,4-trifluorobutyl)-2,3-dihydro-1λ4,5-benzothiazepine-7-carboxamide |
| SMILES | N#Cc1ccc(CN2C(=O)[C@@H](N)CS(=O)c3cc(F)c(C(=O)NCCCC(F)(F)F)cc32)cc1 |
| InChI | InChI=1S/C22H20F4N4O3S/c23-16-9-19-18(8-15(16)20(31)29-7-1-6-22(24,25)26)30(21(32)17(28)12-34(19)33)11-14-4-2-13(10-27)3-5-14/h2-5,8-9,17H,1,6-7,11-12,28H2,(H,29,31)/t17-,34?/m0/s1 |
| InChIKey | HIUNDWLPSRPGOM-PJEDDKAUSA-N |
| XLogP | 2.75 |
| TPSA | 116.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.49 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|